fix: Syntax error

feat(server): Events tracking using Posthog

.env.example

@@ -89,3 +89,7 @@ S3_ACCESS_KEY_ID=
 S3_SECRET_ACCESS_KEY=
 S3_ENDPOINT=
 S3_BUCKET=
+
+# PostHog 
+POSTHOG_API_KEY=
+POSTHOG_HOST=

packages/server/package.json

@@ -37,6 +37,7 @@
     "agendash": "^3.1.0",
     "app-root-path": "^3.0.0",
     "async": "^3.2.0",
+    "async-mutex": "^0.5.0",
     "axios": "^1.6.0",
     "babel-loader": "^9.1.2",
     "bcryptjs": "^2.4.3",
@@ -98,6 +99,7 @@
     "objection-unique": "^1.2.2",
     "plaid": "^10.3.0",
     "pluralize": "^8.0.0",
+    "posthog-node": "^4.2.0",
     "pug": "^3.0.2",
     "puppeteer": "^10.2.0",
     "qim": "0.0.52",

packages/server/src/api/middleware/SubscriptionMiddleware.ts

@@ -1,6 +1,8 @@
 import { Container } from 'typedi';
 import { Request, Response, NextFunction } from 'express';
 
+const SupportedMethods = ['POST', 'PUT'];
+
 export default (subscriptionSlug = 'main') =>
   async (req: Request, res: Response, next: NextFunction) => {
     const { tenant, tenantId } = req;
@@ -19,8 +21,10 @@ export default (subscriptionSlug = 'main') =>
         errors: [{ type: 'TENANT.HAS.NO.SUBSCRIPTION' }],
       });
     }
-    // Validate in case the subscription is inactive.
-    else if (subscription.inactive()) {
+    const isMethodSupported = SupportedMethods.includes(req.method);
+    const isSubscriptionInactive = subscription.inactive();
+
+    if (isMethodSupported && isSubscriptionInactive) {
       return res.boom.badRequest(null, {
         errors: [{ type: 'ORGANIZATION.SUBSCRIPTION.INACTIVE' }],
       });

packages/server/src/config/index.ts

@@ -246,8 +246,19 @@ module.exports = {
     apiKey: process.env.LOOPS_API_KEY,
   },
 
-  oneClickDemoAccounts: parseBoolean(
-    process.env.ONE_CLICK_DEMO_ACCOUNTS,
-    false
-  ),
+  /**
+   * One-click demo accounts.
+   */
+  oneClickDemoAccounts: {
+    enable: parseBoolean(process.env.ONE_CLICK_DEMO_ACCOUNTS, false),
+    demoUrl: process.env.ONE_CLICK_DEMO_ACCOUNTS_URL || '',
+  },
+
+  /**
+   * PostHog
+   */
+  posthog: {
+    apiKey: process.env.POSTHOG_API_KEY,
+    host: process.env.POSTHOG_HOST
+  }
 };

packages/server/src/constants/event-tracker.ts

@@ -0,0 +1,43 @@
+export const SALE_INVOICE_CREATED = 'Sale invoice created';
+export const SALE_INVOICE_EDITED = 'Sale invoice d';
+export const SALE_INVOICE_DELETED = 'Sale invoice deleted';
+export const SALE_INVOICE_MAIL_DELIVERED = 'Sale invoice mail delivered';
+
+export const SALE_ESTIMATE_CREATED = 'Sale estimate created';
+export const SALE_ESTIMATE_EDITED = 'Sale estimate edited';
+export const SALE_ESTIMATE_DELETED = 'Sale estimate deleted';
+
+export const PAYMENT_RECEIVED_CREATED = 'Payment received created';
+export const PAYMENT_RECEIVED_EDITED = 'payment received edited';
+export const PAYMENT_RECEIVED_DELETED = 'Payment received deleted';
+
+export const BILL_CREATED = 'Bill created';
+export const BILL_EDITED = 'Bill edited';
+export const BILL_DELETED = 'Bill deleted';
+
+export const PAYMENT_MADE_CREATED = 'Payment made created';
+export const PAYMENT_MADE_EDITED = 'Payment made edited';
+export const PAYMENT_MADE_DELETED = 'Payment made deleted';
+
+export const EXPENSE_CREATED = 'Expense created';
+export const EXPENSE_EDITED = 'Expense edited';
+export const EXPENSE_DELETED = 'Expense deleted';
+
+export const ACCOUNT_CREATED = 'Account created';
+export const ACCOUNT_EDITED = 'Account Edited';
+export const ACCOUNT_DELETED = 'Account deleted';
+
+export const ITEM_EVENT_CREATED = 'Item created';
+export const ITEM_EVENT_EDITED = 'Item edited';
+export const ITEM_EVENT_DELETED = 'Item deleted';
+
+export const AUTH_SIGNED_UP = 'Auth Signed-up';
+export const AUTH_RESET_PASSWORD = 'Auth reset password';
+
+export const ACCOUNT_GROUP = 'Account';
+export const ITEM_GROUP = 'Item';
+export const AUTH_GROUP = 'Auth';
+export const SALE_GROUP = 'Sale';
+export const PAYMENT_GROUP = 'Payment';
+export const BILL_GROUP = 'Bill';
+export const EXPENSE_GROUP = 'Expense';

packages/server/src/interfaces/Authentication.ts

@@ -76,6 +76,10 @@ export interface IAuthSendedResetPassword {
 
 export interface IAuthGetMetaPOJO {
   signupDisabled: boolean;
+  oneClickDemo: {
+    enable: boolean;
+    demoUrl: string;
+  };
 }
 
 export interface IAuthSignUpVerifingEventPayload {

packages/server/src/interfaces/CreditNote.ts

@@ -1,10 +1,10 @@
 import { Knex } from 'knex';
-import { IDynamicListFilter, IItemEntry, IVendorCredit } from '@/interfaces';
+import { IDynamicListFilter, IItemEntry } from '@/interfaces';
 import { ILedgerEntry } from './Ledger';
 import { AttachmentLinkDTO } from './Attachments';
 
 export interface ICreditNoteEntryNewDTO {
-  index: number;
+  index?: number;
   itemId: number;
   rate: number;
   quantity: number;
@@ -22,7 +22,7 @@ export interface ICreditNoteNewDTO {
   entries: ICreditNoteEntryNewDTO[];
   branchId?: number;
   warehouseId?: number;
-  attachments?: AttachmentLinkDTO[]
+  attachments?: AttachmentLinkDTO[];
 }
 
 export interface ICreditNoteEditDTO {
@@ -35,7 +35,7 @@ export interface ICreditNoteEditDTO {
   entries: ICreditNoteEntryNewDTO[];
   branchId?: number;
   warehouseId?: number;
-  attachments?: AttachmentLinkDTO[]
+  attachments?: AttachmentLinkDTO[];
 }
 
 export interface ICreditNoteEntry extends IItemEntry {}
@@ -61,7 +61,7 @@ export interface ICreditNote {
   localAmount?: number;
   branchId?: number;
   warehouseId: number;
-  createdAt?: Date,
+  createdAt?: Date;
 }
 
 export enum CreditNoteAction {

packages/server/src/interfaces/Import.ts

@@ -3,6 +3,6 @@ import { ImportFilePreviewPOJO } from "@/services/Import/interfaces";
 
 export interface IImportFileCommitedEventPayload {
   tenantId: number;
-  importId: number;
+  importId: string;
   meta: ImportFilePreviewPOJO;
 }

packages/server/src/interfaces/ItemEntry.ts

@@ -48,6 +48,7 @@ export interface IItemEntry {
 
 export interface IItemEntryDTO {
   id?: number;
+  index?: number;
   itemId: number;
   landedCost?: boolean;
   warehouseId?: number;

packages/server/src/interfaces/PaymentReceive.ts

@@ -66,7 +66,7 @@ export interface IPaymentReceivedEntry {
 
 export interface IPaymentReceivedEntryDTO {
   id?: number;
-  index: number;
+  index?: number;
   paymentReceiveId?: number;
   invoiceId: number;
   paymentAmount: number;
@@ -74,6 +74,7 @@ export interface IPaymentReceivedEntryDTO {
 
 export interface IPaymentsReceivedFilter extends IDynamicListFilterDTO {
   stringifiedFilterRoles?: string;
+  filterQuery?: (trx: Knex.Transaction) => void;
 }
 
 export interface IPaymentReceivePageEntry {

packages/server/src/lib/Transformer/Transformer.ts

@@ -2,6 +2,7 @@ import moment from 'moment';
 import * as R from 'ramda';
 import { includes, isFunction, isObject, isUndefined, omit } from 'lodash';
 import { formatNumber, sortObjectKeysAlphabetically } from 'utils';
+import { EXPORT_DTE_FORMAT } from '@/services/Export/constants';
 
 export class Transformer {
   public context: any;
@@ -156,22 +157,34 @@ export class Transformer {
   }
 
   /**
-   *
-   * @param date
-   * @returns
+   * Format date.
+   * @param {} date
+   * @param {string} format -
+   * @returns {}
    */
-  protected formatDate(date) {
-    return date ? moment(date).format(this.dateFormat) : '';
+  protected formatDate(date, format?: string) {
+    // Use the export date format if the async operation is in exporting,
+    // otherwise use the given or default format.
+    const _format = this.context.exportAls.isExport
+      ? EXPORT_DTE_FORMAT
+      : format || this.dateFormat;
+
+    return date ? moment(date).format(_format) : '';
   }
 
-  protected formatDateFromNow(date){
+  /**
+   *
+   * @param date
+   * @returns {}
+   */
+  protected formatDateFromNow(date) {
     return date ? moment(date).fromNow(true) : '';
   }
 
   /**
    *
    * @param number
-   * @returns
+   * @returns {}
    */
   protected formatNumber(number, props?) {
     return formatNumber(number, { money: false, ...props });
@@ -181,7 +194,7 @@ export class Transformer {
    *
    * @param money
    * @param options
-   * @returns
+   * @returns {}
    */
   protected formatMoney(money, options?) {
     return formatNumber(money, {

packages/server/src/lib/Transformer/TransformerInjectable.ts

@@ -3,12 +3,17 @@ import { isNull } from 'lodash';
 import HasTenancyService from '@/services/Tenancy/TenancyService';
 import { TenantMetadata } from '@/system/models';
 import { Transformer } from './Transformer';
+import { ImportAls } from '@/services/Import/ImportALS';
+import { ExportAls } from '@/services/Export/ExportAls';
 
 @Service()
 export class TransformerInjectable {
   @Inject()
   private tenancy: HasTenancyService;
 
+  @Inject()
+  private exportAls: ExportAls;
+
   /**
    * Retrieves the application context of all tenant transformers.
    * @param   {number} tenantId
@@ -17,10 +22,12 @@ export class TransformerInjectable {
   async getApplicationContext(tenantId: number) {
     const i18n = this.tenancy.i18n(tenantId);
     const organization = await TenantMetadata.query().findOne({ tenantId });
+    const exportAls = this.exportAls;
 
     return {
       organization,
       i18n,
+      exportAls,
     };
   }
 

packages/server/src/loaders/eventEmitter.ts

@@ -118,6 +118,7 @@ import { LoopsEventsSubscriber } from '@/services/Loops/LoopsEventsSubscriber';
 import { DeleteUncategorizedTransactionsOnAccountDeleting } from '@/services/Banking/BankAccounts/events/DeleteUncategorizedTransactionsOnAccountDeleting';
 import { SeedInitialDemoAccountDataOnOrgBuild } from '@/services/OneClickDemo/events/SeedInitialDemoAccountData';
 import { TriggerInvalidateCacheOnSubscriptionChange } from '@/services/Subscription/events/TriggerInvalidateCacheOnSubscriptionChange';
+import { EventsTrackerListeners } from '@/services/EventsTracker/events/events';
 
 export default () => {
   return new EventPublisher();
@@ -289,5 +290,7 @@ export const susbcribers = () => {
 
     // Demo Account
     SeedInitialDemoAccountDataOnOrgBuild,
+
+    ...EventsTrackerListeners
   ];
 };

packages/server/src/models/BillPayment.Settings.ts

@@ -5,6 +5,8 @@ export default {
     sortField: 'bill_date',
   },
   exportable: true,
+  exportFlattenOn: 'entries',
+
   importable: true,
   importAggregator: 'group',
   importAggregateOn: 'entries',
@@ -77,7 +79,7 @@ export default {
     paymentDate: {
       name: 'bill_payment.field.payment_date',
       type: 'date',
-      accessor: 'formattedPaymentDate'
+      accessor: 'formattedPaymentDate',
     },
     paymentNumber: {
       name: 'bill_payment.field.payment_number',
@@ -111,6 +113,34 @@ export default {
       name: 'bill_payment.field.reference',
       type: 'text',
     },
+    entries: {
+      name: 'Entries',
+      accessor: 'entries',
+      type: 'collection',
+      collectionOf: 'object',
+      columns: {
+        date: {
+          name: 'Bill date',
+          accessor: 'bill.formattedBillDate',
+        },
+        billNo: {
+          name: 'Bill No.',
+          accessor: 'bill.billNo',
+        },
+        billRefNo: {
+          name: 'Bill Reference No.',
+          accessor: 'bill.referenceNo',
+        },
+        billAmount: {
+          name: 'Bill Amount',
+          accessor: 'bill.totalFormatted',
+        },
+        paidAmount: {
+          name: 'Paid Amount',
+          accessor: 'paymentAmountFormatted',
+        },
+      },
+    },
   },
   fields2: {
     vendorId: {

packages/server/src/models/Customer.Settings.ts

@@ -95,6 +95,11 @@ export default {
     },
   },
   columns: {
+    customerType: {
+      name: 'Customer Type',
+      type: 'text',
+      accessor: 'formattedCustomerType',
+    },
     firstName: {
       name: 'vendor.field.first_name',
       type: 'text',
@@ -135,116 +140,117 @@ export default {
     openingBalance: {
       name: 'vendor.field.opening_balance',
       type: 'number',
-      printable: false
+      printable: false,
     },
     openingBalanceAt: {
       name: 'vendor.field.opening_balance_at',
       type: 'date',
-      printable: false
+      printable: false,
+      accessor: 'formattedOpeningBalanceAt'
     },
     currencyCode: {
       name: 'vendor.field.currency',
       type: 'text',
-      printable: false
+      printable: false,
     },
     status: {
       name: 'vendor.field.status',
-      printable: false
+      printable: false,
     },
     note: {
       name: 'vendor.field.note',
-      printable: false
+      printable: false,
     },
     // Billing Address
     billingAddress1: {
       name: 'Billing Address 1',
       column: 'billing_address1',
       type: 'text',
-      printable: false
+      printable: false,
     },
     billingAddress2: {
       name: 'Billing Address 2',
       column: 'billing_address2',
       type: 'text',
-      printable: false
+      printable: false,
     },
     billingAddressCity: {
       name: 'Billing Address City',
       column: 'billing_address_city',
       type: 'text',
-      printable: false
+      printable: false,
     },
     billingAddressCountry: {
       name: 'Billing Address Country',
       column: 'billing_address_country',
       type: 'text',
-      printable: false
+      printable: false,
     },
     billingAddressPostcode: {
       name: 'Billing Address Postcode',
       column: 'billing_address_postcode',
       type: 'text',
-      printable: false
+      printable: false,
     },
     billingAddressState: {
       name: 'Billing Address State',
       column: 'billing_address_state',
       type: 'text',
-      printable: false
+      printable: false,
     },
     billingAddressPhone: {
       name: 'Billing Address Phone',
       column: 'billing_address_phone',
       type: 'text',
-      printable: false
+      printable: false,
     },
     // Shipping Address
     shippingAddress1: {
       name: 'Shipping Address 1',
       column: 'shipping_address1',
       type: 'text',
-      printable: false
+      printable: false,
     },
     shippingAddress2: {
       name: 'Shipping Address 2',
       column: 'shipping_address2',
       type: 'text',
-      printable: false
+      printable: false,
     },
     shippingAddressCity: {
       name: 'Shipping Address City',
       column: 'shipping_address_city',
       type: 'text',
-      printable: false
+      printable: false,
     },
     shippingAddressCountry: {
       name: 'Shipping Address Country',
       column: 'shipping_address_country',
       type: 'text',
-      printable: false
+      printable: false,
     },
     shippingAddressPostcode: {
       name: 'Shipping Address Postcode',
       column: 'shipping_address_postcode',
       type: 'text',
-      printable: false
+      printable: false,
     },
     shippingAddressPhone: {
       name: 'Shipping Address Phone',
       column: 'shipping_address_phone',
       type: 'text',
-      printable: false
+      printable: false,
     },
     shippingAddressState: {
       name: 'Shipping Address State',
       column: 'shipping_address_state',
       type: 'text',
-      printable: false
+      printable: false,
     },
     createdAt: {
       name: 'vendor.field.created_at',
       type: 'date',
-      printable: false
+      printable: false,
     },
   },
   fields2: {

packages/server/src/models/Item.Settings.ts

@@ -41,17 +41,17 @@ export default {
       fieldType: 'boolean',
     },
     sell_price: {
-      name: 'item.field.cost_price',
+      name: 'item.field.sell_price',
       column: 'sell_price',
       fieldType: 'number',
     },
     cost_price: {
-      name: 'item.field.cost_account',
+      name: 'item.field.cost_price',
       column: 'cost_price',
       fieldType: 'number',
     },
     cost_account: {
-      name: 'item.field.sell_account',
+      name: 'item.field.cost_account',
       column: 'cost_account_id',
       fieldType: 'relation',
 
@@ -62,7 +62,7 @@ export default {
       relationEntityKey: 'slug',
     },
     sell_account: {
-      name: 'item.field.sell_description',
+      name: 'item.field.sell_account',
       column: 'sell_account_id',
       fieldType: 'relation',
 
@@ -155,24 +155,24 @@ export default {
       printable: false,
     },
     sellPrice: {
-      name: 'item.field.cost_price',
+      name: 'item.field.sell_price',
       type: 'number',
       exportable: true,
     },
     costPrice: {
-      name: 'item.field.cost_account',
+      name: 'item.field.cost_price',
       type: 'number',
       exportable: true,
     },
     costAccount: {
-      name: 'item.field.sell_account',
+      name: 'item.field.cost_account',
       type: 'text',
       accessor: 'costAccount.name',
       exportable: true,
       printable: false,
     },
     sellAccount: {
-      name: 'item.field.sell_description',
+      name: 'item.field.sell_account',
       type: 'text',
       accessor: 'sellAccount.name',
       exportable: true,

packages/server/src/models/PaymentReceive.Settings.ts

@@ -1,6 +1,9 @@
 export default {
   importable: true,
+
   exportable: true,
+  exportFlattenOn: 'entries',
+
   importAggregator: 'group',
   importAggregateOn: 'entries',
   importAggregateBy: 'paymentReceiveNo',
@@ -72,7 +75,7 @@ export default {
     amount: {
       name: 'payment_receive.field.amount',
       type: 'number',
-      accessor: 'formattedAmount'
+      accessor: 'formattedAmount',
     },
     referenceNo: {
       name: 'payment_receive.field.reference_no',
@@ -92,6 +95,34 @@ export default {
       type: 'text',
       printable: false,
     },
+    entries: {
+      name: 'Entries',
+      accessor: 'entries',
+      type: 'collection',
+      collectionOf: 'object',
+      columns: {
+        date: {
+          name: 'Invoice date',
+          accessor: 'invoice.invoiceDateFormatted',
+        },
+        invoiceNo: {
+          name: 'Invoice No.',
+          accessor: 'invoice.invoiceNo',
+        },
+        invoiceRefNo: {
+          name: 'Invoice Reference No.',
+          accessor: 'invoice.referenceNo',
+        },
+        invoiceAmount: {
+          name: 'Invoice Amount',
+          accessor: 'invoice.totalFormatted',
+        },
+        paidAmount: {
+          name: 'Paid Amount',
+          accessor: 'paymentAmountFormatted',
+        },
+      },
+    },
     created_at: {
       name: 'payment_receive.field.created_at',
       type: 'date',

packages/server/src/models/SaleEstimate.Settings.ts

@@ -13,7 +13,7 @@ export default {
   importAggregateBy: 'estimateNumber',
 
   print: {
-    pageTitle: 'Sale Estimates'
+    pageTitle: 'Sale Estimates',
   },
 
   fields: {
@@ -142,6 +142,7 @@ export default {
     delivered: {
       name: 'Delivered',
       type: 'boolean',
+      accessor: 'isDelivered',
       exportable: true,
       printable: false,
     },

packages/server/src/models/SaleInvoice.Settings.ts

@@ -155,6 +155,7 @@ export default {
       name: 'invoice.field.delivered',
       type: 'boolean',
       printable: false,
+      accessor: 'isDelivered',
     },
     entries: {
       name: 'Entries',

packages/server/src/services/Accounts/AccountsExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { AccountsApplication } from './AccountsApplication';
 import { Exportable } from '../Export/Exportable';
 import { IAccountsFilter, IAccountsStructureType } from '@/interfaces';
+import { EXPORT_SIZE_LIMIT } from '../Export/constants';
 
 @Service()
 export class AccountsExportable extends Exportable {
@@ -20,7 +21,7 @@ export class AccountsExportable extends Exportable {
       inactiveMode: false,
       ...query,
       structure: IAccountsStructureType.Flat,
-      pageSize: 12000,
+      pageSize: EXPORT_SIZE_LIMIT,
       page: 1,
     } as IAccountsFilter;
 

packages/server/src/services/Authentication/GetAuthMeta.ts

@@ -11,6 +11,10 @@ export class GetAuthMeta {
   public async getAuthMeta(): Promise<IAuthGetMetaPOJO> {
     return {
       signupDisabled: config.signupRestrictions.disabled,
+      oneClickDemo: {
+        enable: config.oneClickDemoAccounts.enable,
+        demoUrl: config.oneClickDemoAccounts.demoUrl,
+      },
     };
   }
 }

packages/server/src/services/Banking/RegonizeTranasctions/events/TriggerRecognizedTransactions.ts

@@ -100,7 +100,6 @@ export class TriggerRecognizedTransactions {
   private async triggerRecognizeTransactionsOnImportCommitted({
     tenantId,
     importId,
-    meta,
   }: IImportFileCommitedEventPayload) {
     const importFile = await Import.query().findOne({ importId });
     const batch = importFile.paramsParsed.batch;

packages/server/src/services/Contacts/Customers/CustomersExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { IItemsFilter } from '@/interfaces';
 import { CustomersApplication } from './CustomersApplication';
 import { Exportable } from '@/services/Export/Exportable';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class CustomersExportable extends Exportable {
@@ -17,9 +18,9 @@ export class CustomersExportable extends Exportable {
     const parsedQuery = {
       sortOrder: 'DESC',
       columnSortBy: 'created_at',
-      page: 1,
       ...query,
-      pageSize: 12,
+      page: 1,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as IItemsFilter;
 
     return this.customersApplication

packages/server/src/services/Contacts/Vendors/VendorsExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { IItemsFilter } from '@/interfaces';
 import { Exportable } from '@/services/Export/Exportable';
 import { VendorsApplication } from './VendorsApplication';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class VendorsExportable extends Exportable {
@@ -17,9 +18,9 @@ export class VendorsExportable extends Exportable {
     const parsedQuery = {
       sortOrder: 'DESC',
       columnSortBy: 'created_at',
-      page: 1,
       ...query,
-      pageSize: 12,
+      page: 1,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as IItemsFilter;
 
     return this.vendorsApplication

packages/server/src/services/CreditNotes/CreditNotes.ts

@@ -5,11 +5,17 @@ import * as R from 'ramda';
 import { ServiceError } from '@/exceptions';
 import HasTenancyService from '@/services/Tenancy/TenancyService';
 import { ERRORS } from './constants';
-import { ICreditNote, ICreditNoteEditDTO, ICreditNoteNewDTO } from '@/interfaces';
+import {
+  ICreditNote,
+  ICreditNoteEditDTO,
+  ICreditNoteEntryNewDTO,
+  ICreditNoteNewDTO,
+} from '@/interfaces';
 import ItemsEntriesService from '@/services/Items/ItemsEntriesService';
 import AutoIncrementOrdersService from '@/services/Sales/AutoIncrementOrdersService';
 import { WarehouseTransactionDTOTransform } from '@/services/Warehouses/Integrations/WarehouseTransactionDTOTransform';
 import { BranchTransactionDTOTransform } from '@/services/Branches/Integrations/BranchTransactionDTOTransform';
+import { assocItemEntriesDefaultIndex } from '../Items/utils';
 
 @Service()
 export default class BaseCreditNotes {
@@ -43,10 +49,17 @@ export default class BaseCreditNotes {
     const amount = this.itemsEntriesService.getTotalItemsEntries(
       creditNoteDTO.entries
     );
-    const entries = creditNoteDTO.entries.map((entry) => ({
-      ...entry,
-      referenceType: 'CreditNote',
-    }));
+    const entries = R.compose(
+      // Associate the default index to each item entry.
+      assocItemEntriesDefaultIndex,
+
+      // Associate the reference type to credit note entries.
+      R.map((entry: ICreditNoteEntryNewDTO) => ({
+        ...entry,
+        referenceType: 'CreditNote',
+      }))
+    )(creditNoteDTO.entries);
+
     // Retreive the next credit note number.
     const autoNextNumber = this.getNextCreditNumber(tenantId);
 

packages/server/src/services/EventsTracker/PostHog.ts

@@ -0,0 +1,24 @@
+import { PostHog } from 'posthog-node';
+import { Service } from 'typedi';
+import { EventMessage } from 'posthog-node/src/types';
+import config from '@/config';
+
+@Service()
+export class PosthogService {
+  public posthog: PostHog;
+
+  constructor() {
+    if (config.posthog.apiKey && config.posthog.host) {
+      this.posthog = new PostHog(config.posthog.apiKey, {
+        host: config.posthog.host,
+      });
+    }
+  }
+
+  public trackEvent(event: EventMessage) {
+    // Cannot continue if the Posthog not configured.
+    if (!this.posthog) return;
+
+    this.posthog.capture(event);
+  }
+}

packages/server/src/services/EventsTracker/events/AccountEventsTracker.ts

@@ -0,0 +1,65 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  IAccountEventCreatedPayload,
+  IAccountEventEditedPayload,
+  IAccountEventDeletedPayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  ACCOUNT_CREATED,
+  ACCOUNT_EDITED,
+  ACCOUNT_DELETED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class AccountEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(
+      events.accounts.onCreated,
+      this.handleTrackAccountCreatedEvent
+    );
+    bus.subscribe(events.accounts.onEdited, this.handleTrackEditedAccountEvent);
+    bus.subscribe(
+      events.accounts.onDeleted,
+      this.handleTrackDeletedAccountEvent
+    );
+  }
+
+  private handleTrackAccountCreatedEvent = ({
+    tenantId,
+  }: IAccountEventCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: ACCOUNT_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedAccountEvent = ({
+    tenantId,
+  }: IAccountEventEditedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: ACCOUNT_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedAccountEvent = ({
+    tenantId,
+  }: IAccountEventDeletedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: ACCOUNT_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/AuthenticationEventsTracker.ts

@@ -0,0 +1,35 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import { IAuthSignedUpEventPayload } from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import { AUTH_SIGNED_UP } from '@/constants/event-tracker';
+import events from '@/subscribers/events';
+
+@Service()
+export class AuthenticationEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(events.auth.signUp, this.handleTrackSignUpEvent);
+  }
+
+  private handleTrackSignUpEvent = ({
+    signupDTO,
+    user,
+    tenant,
+  }: IAuthSignedUpEventPayload) => {
+    this.posthog.trackEvent({
+      distinctId: user.email,
+      event: AUTH_SIGNED_UP,
+      properties: {
+        firstName: user.firstName,
+        lastName: user.lastName,
+        email: user.email,
+      },
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/BillEventsTracker.ts

@@ -0,0 +1,59 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  IBillPaymentEventCreatedPayload,
+  IBillPaymentEventEditedPayload,
+  IBillPaymentEventDeletedPayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  BILL_CREATED,
+  BILL_EDITED,
+  BILL_DELETED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class BillEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(events.bill.onCreated, this.handleTrackBillCreatedEvent);
+    bus.subscribe(events.bill.onEdited, this.handleTrackEditedBillEvent);
+    bus.subscribe(events.bill.onDeleted, this.handleTrackDeletedBillEvent);
+  }
+
+  private handleTrackBillCreatedEvent = ({
+    tenantId,
+  }: IBillPaymentEventCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: BILL_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedBillEvent = ({
+    tenantId,
+  }: IBillPaymentEventEditedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: BILL_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedBillEvent = ({
+    tenantId,
+  }: IBillPaymentEventDeletedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: BILL_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/ExpenseEventsTracker.ts

@@ -0,0 +1,65 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  IExpenseCreatedPayload,
+  IExpenseEventEditPayload,
+  IExpenseEventDeletePayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  EXPENSE_CREATED,
+  EXPENSE_EDITED,
+  EXPENSE_DELETED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class ExpenseEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(
+      events.expenses.onCreated,
+      this.handleTrackExpenseCreatedEvent
+    );
+    bus.subscribe(events.expenses.onEdited, this.handleTrackEditedExpenseEvent);
+    bus.subscribe(
+      events.expenses.onDeleted,
+      this.handleTrackDeletedExpenseEvent
+    );
+  }
+
+  private handleTrackExpenseCreatedEvent = ({
+    tenantId,
+  }: IExpenseCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: EXPENSE_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedExpenseEvent = ({
+    tenantId,
+  }: IExpenseEventEditPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: EXPENSE_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedExpenseEvent = ({
+    tenantId,
+  }: IExpenseEventDeletePayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: EXPENSE_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/ItemEventsTracker.ts

@@ -0,0 +1,59 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  IItemEventCreatedPayload,
+  IItemEventEditedPayload,
+  IItemEventDeletedPayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  ITEM_EVENT_CREATED,
+  ITEM_EVENT_EDITED,
+  ITEM_EVENT_DELETED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class ItemEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(events.item.onCreated, this.handleTrackItemCreatedEvent);
+    bus.subscribe(events.item.onEdited, this.handleTrackEditedItemEvent);
+    bus.subscribe(events.item.onDeleted, this.handleTrackDeletedItemEvent);
+  }
+
+  private handleTrackItemCreatedEvent = ({
+    tenantId,
+  }: IItemEventCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: ITEM_EVENT_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedItemEvent = ({
+    tenantId,
+  }: IItemEventEditedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: ITEM_EVENT_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedItemEvent = ({
+    tenantId,
+  }: IItemEventDeletedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: ITEM_EVENT_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/PaymentMadeEventsTracker.ts

@@ -0,0 +1,68 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  IBillPaymentEventCreatedPayload,
+  IBillPaymentEditingPayload,
+  IBillPaymentEventDeletedPayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  PAYMENT_MADE_CREATED,
+  PAYMENT_MADE_EDITED,
+  PAYMENT_MADE_DELETED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class PaymentMadeEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(
+      events.billPayment.onCreated,
+      this.handleTrackPaymentMadeCreatedEvent
+    );
+    bus.subscribe(
+      events.billPayment.onEdited,
+      this.handleTrackEditedPaymentMadeEvent
+    );
+    bus.subscribe(
+      events.billPayment.onDeleted,
+      this.handleTrackDeletedPaymentMadeEvent
+    );
+  }
+
+  private handleTrackPaymentMadeCreatedEvent = ({
+    tenantId,
+  }: IBillPaymentEventCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: PAYMENT_MADE_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedPaymentMadeEvent = ({
+    tenantId,
+  }: IBillPaymentEditingPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: PAYMENT_MADE_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedPaymentMadeEvent = ({
+    tenantId,
+  }: IBillPaymentEventDeletedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: PAYMENT_MADE_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/PaymentReceivedEventsTracker.ts

@@ -0,0 +1,68 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  IPaymentReceivedCreatedPayload,
+  IPaymentReceivedEditedPayload,
+  IPaymentReceivedDeletedPayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  PAYMENT_RECEIVED_CREATED,
+  PAYMENT_RECEIVED_EDITED,
+  PAYMENT_RECEIVED_DELETED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class PaymentReceivedEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(
+      events.paymentReceive.onCreated,
+      this.handleTrackPaymentReceivedCreatedEvent
+    );
+    bus.subscribe(
+      events.paymentReceive.onEdited,
+      this.handleTrackEditedPaymentReceivedEvent
+    );
+    bus.subscribe(
+      events.paymentReceive.onDeleted,
+      this.handleTrackDeletedPaymentReceivedEvent
+    );
+  }
+
+  private handleTrackPaymentReceivedCreatedEvent = ({
+    tenantId,
+  }: IPaymentReceivedCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: PAYMENT_RECEIVED_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedPaymentReceivedEvent = ({
+    tenantId,
+  }: IPaymentReceivedEditedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: PAYMENT_RECEIVED_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedPaymentReceivedEvent = ({
+    tenantId,
+  }: IPaymentReceivedDeletedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: PAYMENT_RECEIVED_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/SaleEstimateEventsTracker.ts

@@ -0,0 +1,68 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  ISaleEstimateCreatedPayload,
+  ISaleEstimateEditedPayload,
+  ISaleEstimateDeletedPayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  SALE_ESTIMATE_CREATED,
+  SALE_ESTIMATE_EDITED,
+  SALE_ESTIMATE_DELETED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class SaleEstimateEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(
+      events.saleEstimate.onCreated,
+      this.handleTrackEstimateCreatedEvent
+    );
+    bus.subscribe(
+      events.saleEstimate.onEdited,
+      this.handleTrackEditedEstimateEvent
+    );
+    bus.subscribe(
+      events.saleEstimate.onDeleted,
+      this.handleTrackDeletedEstimateEvent
+    );
+  }
+
+  private handleTrackEstimateCreatedEvent = ({
+    tenantId,
+  }: ISaleEstimateCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: SALE_ESTIMATE_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedEstimateEvent = ({
+    tenantId,
+  }: ISaleEstimateEditedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: SALE_ESTIMATE_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedEstimateEvent = ({
+    tenantId,
+  }: ISaleEstimateDeletedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: SALE_ESTIMATE_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/SaleInvoicesEventsTracker.ts

@@ -0,0 +1,67 @@
+import { Inject, Service } from 'typedi';
+import { EventSubscriber } from '@/lib/EventPublisher/EventPublisher';
+import {
+  ISaleInvoiceCreatedPayload,
+  ISaleInvoiceEditedPayload,
+} from '@/interfaces';
+import { PosthogService } from '../PostHog';
+import events from '@/subscribers/events';
+import {
+  SALE_INVOICE_CREATED,
+  SALE_INVOICE_DELETED,
+  SALE_INVOICE_EDITED,
+} from '@/constants/event-tracker';
+
+@Service()
+export class SaleInvoiceEventsTracker extends EventSubscriber {
+  @Inject()
+  private posthog: PosthogService;
+
+  /**
+   * Constructor method.
+   */
+  public attach(bus) {
+    bus.subscribe(
+      events.saleInvoice.onCreated,
+      this.handleTrackInvoiceCreatedEvent
+    );
+    bus.subscribe(
+      events.saleInvoice.onEdited,
+      this.handleTrackEditedInvoiceEvent
+    );
+    bus.subscribe(
+      events.saleInvoice.onDeleted,
+      this.handleTrackDeletedInvoiceEvent
+    );
+  }
+
+  private handleTrackInvoiceCreatedEvent = ({
+    tenantId,
+  }: ISaleInvoiceCreatedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: SALE_INVOICE_CREATED,
+      properties: {},
+    });
+  };
+
+  private handleTrackEditedInvoiceEvent = ({
+    tenantId,
+  }: ISaleInvoiceEditedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: SALE_INVOICE_EDITED,
+      properties: {},
+    });
+  };
+
+  private handleTrackDeletedInvoiceEvent = ({
+    tenantId,
+  }: ISaleInvoiceEditedPayload) => {
+    this.posthog.trackEvent({
+      distinctId: `tenant-${tenantId}`,
+      event: SALE_INVOICE_DELETED,
+      properties: {},
+    });
+  };
+}

packages/server/src/services/EventsTracker/events/events.ts

@@ -0,0 +1,21 @@
+import { SaleInvoiceEventsTracker } from './SaleInvoicesEventsTracker';
+import { SaleEstimateEventsTracker } from './SaleEstimateEventsTracker';
+import { PaymentMadeEventsTracker } from './PaymentMadeEventsTracker';
+import { PaymentReceivedEventsTracker } from './PaymentReceivedEventsTracker';
+import { BillEventsTracker } from './BillEventsTracker';
+import { ExpenseEventsTracker } from './ExpenseEventsTracker';
+import { AccountEventsTracker } from './AccountEventsTracker';
+import { AuthenticationEventsTracker } from './AuthenticationEventsTracker';
+import { ItemEventsTracker } from './ItemEventsTracker';
+
+export const EventsTrackerListeners = [
+  SaleInvoiceEventsTracker,
+  SaleEstimateEventsTracker,
+  PaymentMadeEventsTracker,
+  PaymentReceivedEventsTracker,
+  BillEventsTracker,
+  AccountEventsTracker,
+  ExpenseEventsTracker,
+  AuthenticationEventsTracker,
+  ItemEventsTracker
+];

packages/server/src/services/Expenses/CRUD/ExpenseDTOTransformer.ts

@@ -11,6 +11,7 @@ import {
 } from '@/interfaces';
 import { BranchTransactionDTOTransform } from '@/services/Branches/Integrations/BranchTransactionDTOTransform';
 import { TenantMetadata } from '@/system/models';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 
 @Service()
 export class ExpenseDTOTransformer {
@@ -40,8 +41,8 @@ export class ExpenseDTOTransformer {
 
   /**
    * Mapping expense DTO to model.
-   * @param  {IExpenseDTO} expenseDTO
-   * @param  {ISystemUser} authorizedUser
+   * @param {IExpenseDTO} expenseDTO
+   * @param {ISystemUser} authorizedUser
    * @return {IExpense}
    */
   private expenseDTOToModel(
@@ -52,9 +53,14 @@ export class ExpenseDTOTransformer {
     const landedCostAmount = this.getExpenseLandedCostAmount(expenseDTO);
     const totalAmount = this.getExpenseCategoriesTotal(expenseDTO.categories);
 
+    const categories = R.compose(
+      // Associate the default index to categories lines.
+      assocItemEntriesDefaultIndex
+    )(expenseDTO.categories || []);
+
     const initialDTO = {
-      categories: [],
       ...omit(expenseDTO, ['publish', 'attachments']),
+      categories,
       totalAmount,
       landedCostAmount,
       paymentDate: moment(expenseDTO.paymentDate).toMySqlDateTime(),

packages/server/src/services/Expenses/ExpensesExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { Exportable } from '../Export/Exportable';
 import { IExpensesFilter } from '@/interfaces';
 import { ExpensesApplication } from './ExpensesApplication';
+import { EXPORT_SIZE_LIMIT } from '../Export/constants';
 
 @Service()
 export class ExpensesExportable extends Exportable {
@@ -19,7 +20,7 @@ export class ExpensesExportable extends Exportable {
       columnSortBy: 'created_at',
       ...query,
       page: 1,
-      pageSize: 12000,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as IExpensesFilter;
 
     return this.expensesApplication

packages/server/src/services/Export/ExportAls.ts

@@ -0,0 +1,48 @@
+import { Service } from 'typedi';
+import { AsyncLocalStorage } from 'async_hooks';
+
+@Service()
+export class ExportAls {
+  private als: AsyncLocalStorage<Map<string, any>>;
+
+  constructor() {
+    this.als = new AsyncLocalStorage();
+  }
+
+  /**
+   * Runs a callback function within the context of a new AsyncLocalStorage store.
+   * @param callback The function to be executed within the AsyncLocalStorage context.
+   * @returns The result of the callback function.
+   */
+  public run<T>(callback: () => T): T {
+    return this.als.run<T>(new Map(), () => {
+      this.markAsExport();
+
+      return callback();
+    });
+  }
+
+  /**
+   * Retrieves the current AsyncLocalStorage store.
+   * @returns The current store or undefined if not in a valid context.
+   */
+  public getStore(): Map<string, any> | undefined {
+    return this.als.getStore();
+  }
+
+  /**
+   * Marks the current context as an export operation.
+   * @param flag Boolean flag to set or unset the export status. Defaults to true.
+   */
+  public markAsExport(flag: boolean = true): void {
+    const store = this.getStore();
+    store?.set('isExport', flag);
+  }
+  /**
+   * Checks if the current context is an export operation.
+   * @returns {boolean} True if the context is an export operation, false otherwise.
+   */
+  public get isExport(): boolean {
+    return !!this.getStore()?.get('isExport');
+  }
+}

packages/server/src/services/Export/ExportService.ts

@@ -10,6 +10,7 @@ import { Errors, ExportFormat } from './common';
 import { IModelMeta, IModelMetaColumn } from '@/interfaces';
 import { flatDataCollections, getDataAccessor } from './utils';
 import { ExportPdf } from './ExportPdf';
+import { ExportAls } from './ExportAls';
 
 @Service()
 export class ExportResourceService {
@@ -22,13 +23,33 @@ export class ExportResourceService {
   @Inject()
   private exportPdf: ExportPdf;
 
+  @Inject()
+  private exportAls: ExportAls;
+
+  /**
+   *
+   * @param {number} tenantId
+   * @param {string} resourceName
+   * @param {ExportFormat} format
+   * @returns
+   */
+  public async export(
+    tenantId: number,
+    resourceName: string,
+    format: ExportFormat = ExportFormat.Csv
+  ) {
+    return this.exportAls.run(() =>
+      this.exportAlsRun(tenantId, resourceName, format)
+    );
+  }
+
   /**
    * Exports the given resource data through csv, xlsx or pdf.
    * @param {number} tenantId - Tenant id.
    * @param {string} resourceName - Resource name.
    * @param {ExportFormat} format - File format.
    */
-  public async export(
+  public async exportAlsRun(
     tenantId: number,
     resourceName: string,
     format: ExportFormat = ExportFormat.Csv

packages/server/src/services/Export/constants.ts

@@ -0,0 +1,2 @@
+export const EXPORT_SIZE_LIMIT = 9999999;
+export const EXPORT_DTE_FORMAT = 'YYYY-MM-DD';

packages/server/src/services/Import/ImportALS.ts

@@ -0,0 +1,105 @@
+import { Service } from 'typedi';
+import { AsyncLocalStorage } from 'async_hooks';
+
+@Service()
+export class ImportAls {
+  private als: AsyncLocalStorage<Map<string, any>>;
+
+  constructor() {
+    this.als = new AsyncLocalStorage();
+  }
+
+  /**
+   * Runs a callback function within the context of a new AsyncLocalStorage store.
+   * @param callback The function to be executed within the AsyncLocalStorage context.
+   * @returns The result of the callback function.
+   */
+  public run<T>(callback: () => T): T {
+    return this.als.run<T>(new Map(), callback);
+  }
+
+  /**
+   * Runs a callback function in preview mode within the AsyncLocalStorage context.
+   * @param callback The function to be executed in preview mode.
+   * @returns The result of the callback function.
+   */
+  public runPreview<T>(callback: () => T): T {
+    return this.run(() => {
+      this.markAsImport();
+      this.markAsImportPreview();
+      return callback();
+    });
+  }
+
+  /**
+   * Runs a callback function in commit mode within the AsyncLocalStorage context.
+   * @param {() => T} callback - The function to be executed in commit mode.
+   * @returns {T} The result of the callback function.
+   */
+  public runCommit<T>(callback: () => T): T {
+    return this.run(() => {
+      this.markAsImport();
+      this.markAsImportCommit();
+      return callback();
+    });
+  }
+
+  /**
+   * Retrieves the current AsyncLocalStorage store.
+   * @returns The current store or undefined if not in a valid context.
+   */
+  public getStore(): Map<string, any> | undefined {
+    return this.als.getStore();
+  }
+
+  /**
+   * Marks the current context as an import operation.
+   * @param flag Boolean flag to set or unset the import status. Defaults to true.
+   */
+  public markAsImport(flag: boolean = true): void {
+    const store = this.getStore();
+    store?.set('isImport', flag);
+  }
+
+  /**
+   * Marks the current context as an import commit operation.
+   * @param flag Boolean flag to set or unset the import commit status. Defaults to true.
+   */
+  public markAsImportCommit(flag: boolean = true): void {
+    const store = this.getStore();
+    store?.set('isImportCommit', flag);
+  }
+
+  /**
+   * Marks the current context as an import preview operation.
+   * @param {boolean} flag - Boolean flag to set or unset the import preview status. Defaults to true.
+   */
+  public markAsImportPreview(flag: boolean = true): void {
+    const store = this.getStore();
+    store?.set('isImportPreview', flag);
+  }
+
+  /**
+   * Checks if the current context is an import operation.
+   * @returns {boolean} True if the context is an import operation, false otherwise.
+   */
+  public get isImport(): boolean {
+    return !!this.getStore()?.get('isImport');
+  }
+
+  /**
+   * Checks if the current context is an import commit operation.
+   * @returns {boolean} True if the context is an import commit operation, false otherwise.
+   */
+  public get isImportCommit(): boolean {
+    return !!this.getStore()?.get('isImportCommit');
+  }
+
+  /**
+   * Checks if the current context is an import preview operation.
+   * @returns {boolean} True if the context is an import preview operation, false otherwise.
+   */
+  public get isImportPreview(): boolean {
+    return !!this.getStore()?.get('isImportPreview');
+  }
+}

packages/server/src/services/Import/ImportFileCommon.ts

@@ -1,4 +1,3 @@
-import XLSX from 'xlsx';
 import bluebird from 'bluebird';
 import * as R from 'ramda';
 import { Inject, Service } from 'typedi';
@@ -27,23 +26,7 @@ export class ImportFileCommon {
 
   @Inject()
   private resource: ResourceService;
-
-  /**
-   * Maps the columns of the imported data based on the provided mapping attributes.
-   * @param {Record<string, any>[]} body - The array of data objects to map.
-   * @param {ImportMappingAttr[]} map - The mapping attributes.
-   * @returns {Record<string, any>[]} - The mapped data objects.
-   */
-  public parseXlsxSheet(buffer: Buffer): Record<string, unknown>[] {
-    const workbook = XLSX.read(buffer, { type: 'buffer', raw: true });
-
-    const firstSheetName = workbook.SheetNames[0];
-    const worksheet = workbook.Sheets[firstSheetName];
-
-    return XLSX.utils.sheet_to_json(worksheet, {});
-  }
-
-
+  
   /**
    * Imports the given parsed data to the resource storage through registered importable service.
    * @param {number} tenantId -

packages/server/src/services/Import/ImportFilePreview.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import HasTenancyService from '../Tenancy/TenancyService';
 import { ImportFilePreviewPOJO } from './interfaces';
 import { ImportFileProcess } from './ImportFileProcess';
+import { ImportAls } from './ImportALS';
 
 @Service()
 export class ImportFilePreview {
@@ -11,13 +12,31 @@ export class ImportFilePreview {
   @Inject()
   private importFile: ImportFileProcess;
 
+  @Inject()
+  private importAls: ImportAls;
+
+  /**
+   * Preview the imported file results before commiting the transactions.
+   * @param {number} tenantId - 
+   * @param {string} importId - 
+   * @returns {Promise<ImportFilePreviewPOJO>}
+   */
+  public async preview(
+    tenantId: number,
+    importId: string
+  ): Promise<ImportFilePreviewPOJO> {
+    return this.importAls.runPreview<Promise<ImportFilePreviewPOJO>>(() =>
+      this.previewAlsRun(tenantId, importId)
+    );
+  }
+
   /**
    * Preview the imported file results before commiting the transactions.
    * @param {number} tenantId
    * @param {number} importId
    * @returns {Promise<ImportFilePreviewPOJO>}
    */
-  public async preview(
+  public async previewAlsRun(
     tenantId: number,
     importId: string
   ): Promise<ImportFilePreviewPOJO> {

packages/server/src/services/Import/ImportFileProcess.ts

@@ -2,18 +2,14 @@ import { Inject, Service } from 'typedi';
 import { chain } from 'lodash';
 import { Knex } from 'knex';
 import { ServiceError } from '@/exceptions';
-import {
-  ERRORS,
-  getSheetColumns,
-  getUnmappedSheetColumns,
-  readImportFile,
-} from './_utils';
+import { ERRORS, getUnmappedSheetColumns, readImportFile } from './_utils';
 import { ImportFileCommon } from './ImportFileCommon';
 import { ImportFileDataTransformer } from './ImportFileDataTransformer';
 import ResourceService from '../Resource/ResourceService';
 import UnitOfWork from '../UnitOfWork';
 import { ImportFilePreviewPOJO } from './interfaces';
 import { Import } from '@/system/models';
+import { parseSheetData } from './sheet_utils';
 
 @Service()
 export class ImportFileProcess {
@@ -49,10 +45,10 @@ export class ImportFileProcess {
     if (!importFile.isMapped) {
       throw new ServiceError(ERRORS.IMPORT_FILE_NOT_MAPPED);
     }
-    // Read the imported file.
+    // Read the imported file and parse the given buffer to get columns
+    // and sheet data in json format.
     const buffer = await readImportFile(importFile.filename);
-    const sheetData = this.importCommon.parseXlsxSheet(buffer);
-    const header = getSheetColumns(sheetData);
+    const [sheetData, sheetColumns] = parseSheetData(buffer);
 
     const resource = importFile.resource;
     const resourceFields = this.resource.getResourceFields2(tenantId, resource);
@@ -87,7 +83,7 @@ export class ImportFileProcess {
       .flatten()
       .value();
 
-    const unmappedColumns = getUnmappedSheetColumns(header, mapping);
+    const unmappedColumns = getUnmappedSheetColumns(sheetColumns, mapping);
     const totalCount = allData.length;
 
     const createdCount = successedImport.length;

packages/server/src/services/Import/ImportFileProcessCommit.ts

@@ -5,6 +5,7 @@ import { ImportFileProcess } from './ImportFileProcess';
 import { EventPublisher } from '@/lib/EventPublisher/EventPublisher';
 import events from '@/subscribers/events';
 import { IImportFileCommitedEventPayload } from '@/interfaces/Import';
+import { ImportAls } from './ImportALS';
 
 @Service()
 export class ImportFileProcessCommit {
@@ -14,16 +15,34 @@ export class ImportFileProcessCommit {
   @Inject()
   private importFile: ImportFileProcess;
 
+  @Inject()
+  private importAls: ImportAls;
+
   @Inject()
   private eventPublisher: EventPublisher;
 
+  /**
+   * Commits the imported file under ALS.
+   * @param {number} tenantId
+   * @param {string} importId
+   * @returns {Promise<ImportFilePreviewPOJO>}
+   */
+  public commit(
+    tenantId: number,
+    importId: string
+  ): Promise<ImportFilePreviewPOJO> {
+    return this.importAls.runCommit<Promise<ImportFilePreviewPOJO>>(() =>
+      this.commitAlsRun(tenantId, importId)
+    );
+  }
+
   /**
    * Commits the imported file.
    * @param {number} tenantId
    * @param {number} importId
    * @returns {Promise<ImportFilePreviewPOJO>}
    */
-  public async commit(
+  public async commitAlsRun(
     tenantId: number,
     importId: string
   ): Promise<ImportFilePreviewPOJO> {

packages/server/src/services/Import/ImportFileUpload.ts

@@ -11,6 +11,7 @@ import { ImportFileCommon } from './ImportFileCommon';
 import { ImportFileDataValidator } from './ImportFileDataValidator';
 import { ImportFileUploadPOJO } from './interfaces';
 import { Import } from '@/system/models';
+import { parseSheetData } from './sheet_utils';
 
 @Service()
 export class ImportFileUploadService {
@@ -77,14 +78,12 @@ export class ImportFileUploadService {
     const buffer = await readImportFile(filename);
 
     // Parse the buffer file to array data.
-    const sheetData = this.importFileCommon.parseXlsxSheet(buffer);
+    const [sheetData, sheetColumns] = parseSheetData(buffer);
+    const coumnsStringified = JSON.stringify(sheetColumns);
 
     // Throws service error if the sheet data is empty.
     validateSheetEmpty(sheetData);
 
-    const sheetColumns = this.importFileCommon.parseSheetColumns(sheetData);
-    const coumnsStringified = JSON.stringify(sheetColumns);
-
     try {
       // Validates the params Yup schema.
       await this.importFileCommon.validateParamsSchema(resource, params);

packages/server/src/services/Import/sheet_utils.ts

@@ -0,0 +1,56 @@
+import XLSX from 'xlsx';
+import { first } from 'lodash';
+
+/**
+ * Parses the given sheet buffer to worksheet.
+ * @param {Buffer} buffer
+ * @returns {XLSX.WorkSheet}
+ */
+export function parseFirstSheet(buffer: Buffer): XLSX.WorkSheet {
+  const workbook = XLSX.read(buffer, { type: 'buffer', raw: true });
+
+  const firstSheetName = workbook.SheetNames[0];
+  const worksheet = workbook.Sheets[firstSheetName];
+
+  return worksheet;
+}
+
+/**
+ * Extracts the given worksheet to columns.
+ * @param {XLSX.WorkSheet} worksheet
+ * @returns {Array<string>}
+ */
+export function extractSheetColumns(worksheet: XLSX.WorkSheet): Array<string> {
+  // By default, sheet_to_json scans the first row and uses the values as headers.
+  // With the header: 1 option, the function exports an array of arrays of values.
+  const sheetCells = XLSX.utils.sheet_to_json(worksheet, { header: 1 });
+  const sheetCols = first(sheetCells) as Array<string>;
+
+  return sheetCols.filter((col) => col);
+}
+
+/**
+ * Parses the given worksheet to json values. the keys are columns labels.
+ * @param {XLSX.WorkSheet} worksheet
+ * @returns {Array<Record<string, string>>}
+ */
+export function parseSheetToJson(
+  worksheet: XLSX.WorkSheet
+): Array<Record<string, string>> {
+  return XLSX.utils.sheet_to_json(worksheet, {});
+}
+
+/**
+ * Parses the given sheet buffer then retrieves the sheet data and columns.
+ * @param {Buffer} buffer
+ */
+export function parseSheetData(
+  buffer: Buffer
+): [Array<Record<string, string>>, string[]] {
+  const worksheet = parseFirstSheet(buffer);
+
+  const columns = extractSheetColumns(worksheet);
+  const data = parseSheetToJson(worksheet);
+
+  return [data, columns];
+}

packages/server/src/services/Inventory/Inventory.ts

@@ -139,24 +139,25 @@ export default class InventoryService {
   ) {
     const agenda = Container.get('agenda');
 
+    const commonJobsQuery = {
+      name: 'compute-item-cost',
+      lastRunAt: { $exists: false },
+      'data.tenantId': tenantId,
+      'data.itemId': itemId,
+    };
     // Cancel any `compute-item-cost` in the queue has upper starting date
     // with the same given item.
     await agenda.cancel({
-      name: 'compute-item-cost',
-      nextRunAt: { $ne: null },
-      'data.tenantId': tenantId,
-      'data.itemId': itemId,
-      'data.startingDate': { $gt: startingDate },
+      ...commonJobsQuery,
+      'data.startingDate': { $lte: startingDate },
     });
     // Retrieve any `compute-item-cost` in the queue has lower starting date
     // with the same given item.
     const dependsJobs = await agenda.jobs({
-      name: 'compute-item-cost',
-      nextRunAt: { $ne: null },
-      'data.tenantId': tenantId,
-      'data.itemId': itemId,
-      'data.startingDate': { $lte: startingDate },
+      ...commonJobsQuery,
+      'data.startingDate': { $gte: startingDate },
     });
+    // If the depends jobs cleared.
     if (dependsJobs.length === 0) {
       await agenda.schedule(
         config.scheduleComputeItemCost,
@@ -172,6 +173,13 @@ export default class InventoryService {
         events.inventory.onComputeItemCostJobScheduled,
         { startingDate, itemId, tenantId } as IInventoryItemCostScheduledPayload
       );
+    } else {
+      // Re-schedule the jobs that have higher date from current moment.
+      await Promise.all(
+        dependsJobs.map((job) =>
+          job.schedule(config.scheduleComputeItemCost).save()
+        )
+      );
     }
   }
 

packages/server/src/services/Items/ItemsExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { Exportable } from '../Export/Exportable';
 import { IItemsFilter } from '@/interfaces';
 import { ItemsApplication } from './ItemsApplication';
+import { EXPORT_SIZE_LIMIT } from '../Export/constants';
 
 @Service()
 export class ItemsExportable extends Exportable {
@@ -19,7 +20,7 @@ export class ItemsExportable extends Exportable {
       columnSortBy: 'created_at',
       page: 1,
       ...query,
-      pageSize: 12,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as IItemsFilter;
 
     return this.itemsApplication

packages/server/src/services/Items/utils.ts

@@ -0,0 +1,16 @@
+import { IItemEntry } from '@/interfaces';
+import { isNull, isUndefined } from 'lodash';
+
+export function assocItemEntriesDefaultIndex<T>(
+  entries: Array<T & { index?: number }>
+): Array<T & { index: number }> {
+  return entries.map((entry, index) => {
+    return {
+      index:
+        isUndefined(entry.index) || isNull(entry.index)
+          ? index + 1
+          : entry.index,
+      ...entry,
+    };
+  });
+}

packages/server/src/services/ManualJournals/CreateManualJournal.ts

@@ -18,6 +18,8 @@ import { EventPublisher } from '@/lib/EventPublisher/EventPublisher';
 import { CommandManualJournalValidators } from './CommandManualJournalValidators';
 import { AutoIncrementManualJournal } from './AutoIncrementManualJournal';
 import { ManualJournalBranchesDTOTransformer } from '@/services/Branches/Integrations/ManualJournals/ManualJournalDTOTransformer';
+import { assocItemEntriesDefaultIndex } from '../Items/utils';
+
 @Service()
 export class CreateManualJournalService {
   @Inject()
@@ -58,16 +60,22 @@ export class CreateManualJournalService {
     // The manual or auto-increment journal number.
     const journalNumber = manualJournalDTO.journalNumber || autoNextNumber;
 
+    const entries = R.compose(
+      // Associate the default index to each item entry.
+      assocItemEntriesDefaultIndex
+    )(manualJournalDTO.entries);
+
     const initialDTO = {
       ...omit(manualJournalDTO, ['publish', 'attachments']),
       ...(manualJournalDTO.publish
         ? { publishedAt: moment().toMySqlDateTime() }
         : {}),
       amount,
+      date,
       currencyCode: manualJournalDTO.currencyCode || baseCurrency,
       exchangeRate: manualJournalDTO.exchangeRate || 1,
-      date,
       journalNumber,
+      entries,
       userId: authorizedUser.id,
     };
     return R.compose(

packages/server/src/services/ManualJournals/ManualJournalExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { IManualJournalsFilter } from '@/interfaces';
 import { Exportable } from '../Export/Exportable';
 import { ManualJournalsApplication } from './ManualJournalsApplication';
+import { EXPORT_SIZE_LIMIT } from '../Export/constants';
 
 @Service()
 export class ManualJournalsExportable extends Exportable {
@@ -19,7 +20,7 @@ export class ManualJournalsExportable extends Exportable {
       columnSortBy: 'created_at',
       ...query,
       page: 1,
-      pageSize: 12000,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as IManualJournalsFilter;
 
     return this.manualJournalsApplication

packages/server/src/services/Purchases/BillPayments/BillPaymentExportable.ts

@@ -1,6 +1,7 @@
 import { Inject, Service } from 'typedi';
 import { Exportable } from '@/services/Export/Exportable';
 import { BillPaymentsApplication } from './BillPaymentsApplication';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class BillPaymentExportable extends Exportable {
@@ -13,12 +14,16 @@ export class BillPaymentExportable extends Exportable {
    * @returns
    */
   public exportable(tenantId: number, query: any) {
+    const filterQuery = (builder) => {
+      builder.withGraphFetched('entries.bill');
+    };
     const parsedQuery = {
-      page: 1,
-      pageSize: 12,
-      ...query,
       sortOrder: 'desc',
       columnSortBy: 'created_at',
+      ...query,
+      page: 1,
+      pageSize: EXPORT_SIZE_LIMIT,
+      filterQuery
     } as any;
 
     return this.billPaymentsApplication

packages/server/src/services/Purchases/BillPayments/CommandBillPaymentDTOTransformer.ts

@@ -3,8 +3,8 @@ import * as R from 'ramda';
 import { omit, sumBy } from 'lodash';
 import { IBillPayment, IBillPaymentDTO, IVendor } from '@/interfaces';
 import { BranchTransactionDTOTransform } from '@/services/Branches/Integrations/BranchTransactionDTOTransform';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 import { formatDateFields } from '@/utils';
-import HasTenancyService from '@/services/Tenancy/TenancyService';
 
 @Service()
 export class CommandBillPaymentDTOTransformer {
@@ -27,6 +27,12 @@ export class CommandBillPaymentDTOTransformer {
     const amount =
       billPaymentDTO.amount ?? sumBy(billPaymentDTO.entries, 'paymentAmount');
 
+    // Associate the default index to each item entry.
+    const entries = R.compose(
+      // Associate the default index to payment entries.
+      assocItemEntriesDefaultIndex
+    )(billPaymentDTO.entries);
+
     const initialDTO = {
       ...formatDateFields(omit(billPaymentDTO, ['attachments']), [
         'paymentDate',
@@ -34,7 +40,7 @@ export class CommandBillPaymentDTOTransformer {
       amount,
       currencyCode: vendor.currencyCode,
       exchangeRate: billPaymentDTO.exchangeRate || 1,
-      entries: billPaymentDTO.entries,
+      entries,
     };
     return R.compose(
       this.branchDTOTransform.transformDTO<IBillPayment>(tenantId)

packages/server/src/services/Purchases/BillPayments/GetBillPayments.ts

@@ -52,6 +52,7 @@ export class GetBillPayments {
         builder.withGraphFetched('paymentAccount');
 
         dynamicList.buildQuery()(builder);
+        filter?.filterQuery && filter?.filterQuery(builder);
       })
       .pagination(filter.page - 1, filter.pageSize);
 

packages/server/src/services/Purchases/Bills/BillDTOTransformer.ts

@@ -3,7 +3,7 @@ import moment from 'moment';
 import { Inject, Service } from 'typedi';
 import * as R from 'ramda';
 import composeAsync from 'async/compose';
-import { formatDateFields } from 'utils';
+import { assocDepthLevelToObjectTree, formatDateFields } from 'utils';
 import {
   IBillDTO,
   IBill,
@@ -15,6 +15,7 @@ import { BranchTransactionDTOTransform } from '@/services/Branches/Integrations/
 import { WarehouseTransactionDTOTransform } from '@/services/Warehouses/Integrations/WarehouseTransactionDTOTransform';
 import HasTenancyService from '@/services/Tenancy/TenancyService';
 import { ItemEntriesTaxTransactions } from '@/services/TaxRates/ItemEntriesTaxTransactions';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 
 @Service()
 export class BillDTOTransformer {
@@ -54,9 +55,9 @@ export class BillDTOTransformer {
 
   /**
    * Converts create bill DTO to model.
-   * @param   {number} tenantId
-   * @param   {IBillDTO} billDTO
-   * @param   {IBill} oldBill
+   * @param {number} tenantId
+   * @param {IBillDTO} billDTO
+   * @param {IBill} oldBill
    * @returns {IBill}
    */
   public async billDTOToModel(
@@ -92,7 +93,9 @@ export class BillDTOTransformer {
 
     const entries = R.compose(
       // Remove tax code from entries.
-      R.map(R.omit(['taxCode']))
+      R.map(R.omit(['taxCode'])),
+      // Associate the default index to each item entry line.
+      assocItemEntriesDefaultIndex
     )(asyncEntries);
 
     const initialDTO = {

packages/server/src/services/Purchases/Bills/BillsExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { IBillsFilter } from '@/interfaces';
 import { Exportable } from '@/services/Export/Exportable';
 import { BillsApplication } from './BillsApplication';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class BillsExportable extends Exportable {
@@ -19,7 +20,7 @@ export class BillsExportable extends Exportable {
       columnSortBy: 'created_at',
       ...query,
       page: 1,
-      pageSize: 12000,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as IBillsFilter;
 
     return this.billsApplication

packages/server/src/services/Purchases/VendorCredits/BaseVendorCredit.ts

@@ -9,11 +9,13 @@ import {
   IVendorCredit,
   IVendorCreditCreateDTO,
   IVendorCreditEditDTO,
+  IVendorCreditEntryDTO,
 } from '@/interfaces';
 import ItemsEntriesService from '@/services/Items/ItemsEntriesService';
 import AutoIncrementOrdersService from '@/services/Sales/AutoIncrementOrdersService';
 import { BranchTransactionDTOTransform } from '@/services/Branches/Integrations/BranchTransactionDTOTransform';
 import { WarehouseTransactionDTOTransform } from '@/services/Warehouses/Integrations/WarehouseTransactionDTOTransform';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 
 @Service()
 export default class BaseVendorCredit {
@@ -50,10 +52,18 @@ export default class BaseVendorCredit {
     const amount = this.itemsEntriesService.getTotalItemsEntries(
       vendorCreditDTO.entries
     );
-    const entries = vendorCreditDTO.entries.map((entry) => ({
-      ...entry,
-      referenceType: 'VendorCredit',
-    }));
+
+    const entries = R.compose(
+      // Associate the default index to each item entry.
+      assocItemEntriesDefaultIndex,
+
+      // Associate the reference type to item entries.
+      R.map((entry: IVendorCreditEntryDTO) => ({
+        referenceType: 'VendorCredit',
+        ...entry,
+      }))
+    )(vendorCreditDTO.entries);
+
     // Retreive the next vendor credit number.
     const autoNextNumber = this.getNextCreditNumber(tenantId);
 

packages/server/src/services/Sales/Estimates/SaleEstimateDTOTransformer.ts

@@ -9,6 +9,7 @@ import { WarehouseTransactionDTOTransform } from '@/services/Warehouses/Integrat
 import { formatDateFields } from '@/utils';
 import moment from 'moment';
 import { SaleEstimateIncrement } from './SaleEstimateIncrement';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 
 @Service()
 export class SaleEstimateDTOTransformer {
@@ -56,6 +57,14 @@ export class SaleEstimateDTOTransformer {
     // Validate the sale estimate number require.
     this.validators.validateEstimateNoRequire(estimateNumber);
 
+    const entries = R.compose(
+      // Associate the reference type to item entries.
+      R.map((entry) => R.assoc('reference_type', 'SaleEstimate', entry)),
+
+      // Associate default index to item entries.
+      assocItemEntriesDefaultIndex
+    )(estimateDTO.entries);
+
     const initialDTO = {
       amount,
       ...formatDateFields(
@@ -65,10 +74,7 @@ export class SaleEstimateDTOTransformer {
       currencyCode: paymentCustomer.currencyCode,
       exchangeRate: estimateDTO.exchangeRate || 1,
       ...(estimateNumber ? { estimateNumber } : {}),
-      entries: estimateDTO.entries.map((entry) => ({
-        reference_type: 'SaleEstimate',
-        ...entry,
-      })),
+      entries,
       // Avoid rewrite the deliver date in edit mode when already published.
       ...(estimateDTO.delivered &&
         !oldSaleEstimate?.deliveredAt && {

packages/server/src/services/Sales/Estimates/SaleEstimatesExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { ISalesInvoicesFilter } from '@/interfaces';
 import { Exportable } from '@/services/Export/Exportable';
 import { SaleEstimatesApplication } from './SaleEstimatesApplication';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class SaleEstimatesExportable extends Exportable {
@@ -19,7 +20,7 @@ export class SaleEstimatesExportable extends Exportable {
       columnSortBy: 'created_at',
       ...query,
       page: 1,
-      pageSize: 12000,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as ISalesInvoicesFilter;
 
     return this.saleEstimatesApplication

packages/server/src/services/Sales/Invoices/CommandSaleInvoiceDTOTransformer.ts

@@ -17,6 +17,7 @@ import { CommandSaleInvoiceValidators } from './CommandSaleInvoiceValidators';
 import { SaleInvoiceIncrement } from './SaleInvoiceIncrement';
 import { formatDateFields } from 'utils';
 import { ItemEntriesTaxTransactions } from '@/services/TaxRates/ItemEntriesTaxTransactions';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 import { ItemEntry } from '@/models';
 
 @Service()
@@ -81,7 +82,10 @@ export class CommandSaleInvoiceDTOTransformer {
 
     const entries = R.compose(
       // Remove tax code from entries.
-      R.map(R.omit(['taxCode']))
+      R.map(R.omit(['taxCode'])),
+
+      // Associate the default index for each item entry lin.
+      assocItemEntriesDefaultIndex
     )(asyncEntries);
 
     const initialDTO = {

packages/server/src/services/Sales/Invoices/SaleInvoicesExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { ISalesInvoicesFilter } from '@/interfaces';
 import { SaleInvoiceApplication } from './SaleInvoicesApplication';
 import { Exportable } from '@/services/Export/Exportable';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class SaleInvoicesExportable extends Exportable {
@@ -19,7 +20,7 @@ export class SaleInvoicesExportable extends Exportable {
       columnSortBy: 'created_at',
       ...query,
       page: 1,
-      pageSize: 120000,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as ISalesInvoicesFilter;
 
     return this.saleInvoicesApplication

packages/server/src/services/Sales/Invoices/SalesInvoicesCost.ts

@@ -1,3 +1,4 @@
+import { Mutex } from 'async-mutex';
 import { Container, Service, Inject } from 'typedi';
 import { chain } from 'lodash';
 import moment from 'moment';
@@ -34,17 +35,26 @@ export class SaleInvoicesCost {
     inventoryItemsIds: number[],
     startingDate: Date
   ): Promise<void> {
-    const asyncOpers: Promise<[]>[] = [];
+    const mutex = new Mutex();
 
-    inventoryItemsIds.forEach((inventoryItemId: number) => {
-      const oper: Promise<[]> = this.inventoryService.scheduleComputeItemCost(
-        tenantId,
-        inventoryItemId,
-        startingDate
-      );
-      asyncOpers.push(oper);
-    });
-    await Promise.all([...asyncOpers]);
+    const asyncOpers = inventoryItemsIds.map(
+      async (inventoryItemId: number) => {
+        // @todo refactor the lock acquire to be distrbuted using Redis
+        // and run the cost schedule job after running invoice transaction.
+        const release = await mutex.acquire();
+
+        try {
+          await this.inventoryService.scheduleComputeItemCost(
+            tenantId,
+            inventoryItemId,
+            startingDate
+          );
+        } finally {
+          release();
+        }
+      }
+    );
+    await Promise.all(asyncOpers);
   }
 
   /**
@@ -86,17 +96,22 @@ export class SaleInvoicesCost {
     tenantId: number,
     inventoryTransactions: IInventoryTransaction[]
   ) {
-    const asyncOpers: Promise<[]>[] = [];
+    const mutex = new Mutex();
     const reducedTransactions = this.getMaxDateInventoryTransactions(
       inventoryTransactions
     );
-    reducedTransactions.forEach((transaction) => {
-      const oper: Promise<[]> = this.inventoryService.scheduleComputeItemCost(
-        tenantId,
-        transaction.itemId,
-        transaction.date
-      );
-      asyncOpers.push(oper);
+    const asyncOpers = reducedTransactions.map(async (transaction) => {
+      const release = await mutex.acquire();
+
+      try {
+        await this.inventoryService.scheduleComputeItemCost(
+          tenantId,
+          transaction.itemId,
+          transaction.date
+        );
+      } finally {
+        release();
+      }
     });
     await Promise.all([...asyncOpers]);
   }

packages/server/src/services/Sales/PaymentReceived/GetPaymentsReceived.ts

@@ -50,7 +50,9 @@ export class GetPaymentReceives {
       .onBuild((builder) => {
         builder.withGraphFetched('customer');
         builder.withGraphFetched('depositAccount');
+
         dynamicList.buildQuery()(builder);
+        filterDTO?.filterQuery && filterDTO.filterQuery(builder);
       })
       .pagination(filter.page - 1, filter.pageSize);
 

packages/server/src/services/Sales/PaymentReceived/PaymentReceivedDTOTransformer.ts

@@ -11,6 +11,7 @@ import { PaymentReceivedValidators } from './PaymentReceivedValidators';
 import { PaymentReceivedIncrement } from './PaymentReceivedIncrement';
 import { BranchTransactionDTOTransform } from '@/services/Branches/Integrations/BranchTransactionDTOTransform';
 import { formatDateFields } from '@/utils';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 
 @Service()
 export class PaymentReceiveDTOTransformer {
@@ -52,6 +53,11 @@ export class PaymentReceiveDTOTransformer {
 
     this.validators.validatePaymentNoRequire(paymentReceiveNo);
 
+    const entries = R.compose(
+      // Associate the default index to each item entry line.
+      assocItemEntriesDefaultIndex
+    )(paymentReceiveDTO.entries);
+
     const initialDTO = {
       ...formatDateFields(omit(paymentReceiveDTO, ['entries', 'attachments']), [
         'paymentDate',
@@ -60,9 +66,7 @@ export class PaymentReceiveDTOTransformer {
       currencyCode: customer.currencyCode,
       ...(paymentReceiveNo ? { paymentReceiveNo } : {}),
       exchangeRate: paymentReceiveDTO.exchangeRate || 1,
-      entries: paymentReceiveDTO.entries.map((entry) => ({
-        ...entry,
-      })),
+      entries,
     };
     return R.compose(
       this.branchDTOTransform.transformDTO<IPaymentReceived>(tenantId)

packages/server/src/services/Sales/PaymentReceived/PaymentsReceivedExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { IAccountsStructureType, IPaymentsReceivedFilter } from '@/interfaces';
 import { Exportable } from '@/services/Export/Exportable';
 import { PaymentReceivesApplication } from './PaymentReceivedApplication';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class PaymentsReceivedExportable extends Exportable {
@@ -15,12 +16,19 @@ export class PaymentsReceivedExportable extends Exportable {
    * @returns
    */
   public exportable(tenantId: number, query: IPaymentsReceivedFilter) {
+    const filterQuery = (builder) => {
+      builder.withGraphFetched('entries.invoice');
+    };
+
     const parsedQuery = {
       sortOrder: 'desc',
       columnSortBy: 'created_at',
       inactiveMode: false,
       ...query,
       structure: IAccountsStructureType.Flat,
+      page: 1,
+      pageSize: EXPORT_SIZE_LIMIT,
+      filterQuery,
     } as IPaymentsReceivedFilter;
 
     return this.paymentReceivedApp

packages/server/src/services/Sales/Receipts/SaleReceiptDTOTransformer.ts

@@ -11,6 +11,7 @@ import { ICustomer, ISaleReceipt, ISaleReceiptDTO } from '@/interfaces';
 import { formatDateFields } from '@/utils';
 import { SaleReceiptIncrement } from './SaleReceiptIncrement';
 import { ItemEntry } from '@/models';
+import { assocItemEntriesDefaultIndex } from '@/services/Items/utils';
 
 @Service()
 export class SaleReceiptDTOTransformer {
@@ -61,11 +62,16 @@ export class SaleReceiptDTOTransformer {
       ...entry,
     }));
 
-    const entries = await composeAsync(
+    const asyncEntries = await composeAsync(
       // Sets default cost and sell account to receipt items entries.
       this.itemsEntriesService.setItemsEntriesDefaultAccounts(tenantId)
     )(initialEntries);
 
+    const entries = R.compose(
+      // Associate the default index for each item entry.
+      assocItemEntriesDefaultIndex
+    )(asyncEntries);
+
     const initialDTO = {
       amount,
       ...formatDateFields(

packages/server/src/services/Sales/Receipts/SaleReceiptsExportable.ts

@@ -2,6 +2,7 @@ import { Inject, Service } from 'typedi';
 import { ISalesReceiptsFilter } from '@/interfaces';
 import { Exportable } from '@/services/Export/Exportable';
 import { SaleReceiptApplication } from './SaleReceiptApplication';
+import { EXPORT_SIZE_LIMIT } from '@/services/Export/constants';
 
 @Service()
 export class SaleReceiptsExportable extends Exportable {
@@ -19,7 +20,7 @@ export class SaleReceiptsExportable extends Exportable {
       columnSortBy: 'created_at',
       ...query,
       page: 1,
-      pageSize: 12,
+      pageSize: EXPORT_SIZE_LIMIT,
     } as ISalesReceiptsFilter;
 
     return this.saleReceiptsApp

packages/server/src/services/Subscription/LemonResumeSubscription.ts

@@ -18,7 +18,10 @@ export class LemonResumeSubscription {
    * @param {string} subscriptionSlug - Subscription slug by default main subscription.
    * @returns {Promise<void>}
    */
-  public async resumeSubscription(tenantId: number, subscriptionSlug: string = 'main') {
+  public async resumeSubscription(
+    tenantId: number,
+    subscriptionSlug: string = 'main'
+  ) {
     configureLemonSqueezy();
 
     const subscription = await PlanSubscription.query().findOne({
@@ -34,7 +37,7 @@ export class LemonResumeSubscription {
       cancelled: false,
     });
     if (returnedSub.error) {
-      throw new ServiceError(ٌٌُERRORS.SOMETHING_WENT_WRONG_WITH_LS);
+      throw new ServiceError(ERRORS.SOMETHING_WENT_WRONG_WITH_LS);
     }
     // Triggers `onSubscriptionResume` event.
     await this.eventPublisher.emitAsync(

packages/server/src/subscribers/Inventory/Inventory.ts

@@ -10,6 +10,7 @@ import {
 } from '@/interfaces';
 import { runAfterTransaction } from '@/services/UnitOfWork/TransactionsHooks';
 import { SaleInvoicesCost } from '@/services/Sales/Invoices/SalesInvoicesCost';
+import { ImportAls } from '@/services/Import/ImportALS';
 
 @Service()
 export default class InventorySubscriber {
@@ -25,6 +26,9 @@ export default class InventorySubscriber {
   @Inject('agenda')
   private agenda: any;
 
+  @Inject()
+  private importAls: ImportAls;
+
   /**
    * Attaches events with handlers.
    */
@@ -86,20 +90,17 @@ export default class InventorySubscriber {
   private handleScheduleItemsCostOnInventoryTransactionsCreated = async ({
     tenantId,
     inventoryTransactions,
-    trx
+    trx,
   }: IInventoryTransactionsCreatedPayload) => {
-    const inventoryItemsIds = map(inventoryTransactions, 'itemId');
+    const inImportPreviewScope = this.importAls.isImportPreview;
 
-    runAfterTransaction(trx, async () => {
-      try {
-        await this.saleInvoicesCost.computeItemsCostByInventoryTransactions(
-          tenantId,
-          inventoryTransactions
-        );
-      } catch (error) {
-        console.error(error);
-      }
-    });
+    // Avoid running the cost items job if the async process is in import preview.
+    if (inImportPreviewScope) return;
+
+    await this.saleInvoicesCost.computeItemsCostByInventoryTransactions(
+      tenantId,
+      inventoryTransactions
+    );
   };
 
   /**

packages/server/src/system/models/Subscriptions/PlanSubscription.ts

@@ -2,6 +2,7 @@ import { Model, mixin } from 'objection';
 import SystemModel from '@/system/models/SystemModel';
 import moment from 'moment';
 import SubscriptionPeriod from '@/services/Subscription/SubscriptionPeriod';
+import { SubscriptionPaymentStatus } from '@/interfaces';
 
 export default class PlanSubscription extends mixin(SystemModel) {
   public lemonSubscriptionId: number;
@@ -13,6 +14,8 @@ export default class PlanSubscription extends mixin(SystemModel) {
 
   public trialEndsAt: Date;
 
+  public paymentStatus: SubscriptionPaymentStatus;
+
   /**
    * Table name.
    */
@@ -31,7 +34,16 @@ export default class PlanSubscription extends mixin(SystemModel) {
    * Defined virtual attributes.
    */
   static get virtualAttributes() {
-    return ['active', 'inactive', 'ended', 'canceled', 'onTrial', 'status'];
+    return [
+      'active',
+      'inactive',
+      'ended',
+      'canceled',
+      'onTrial',
+      'status',
+      'isPaymentFailed',
+      'isPaymentSucceed',
+    ];
   }
 
   /**
@@ -69,6 +81,22 @@ export default class PlanSubscription extends mixin(SystemModel) {
 
         builder.where('trial_ends_at', '<=', endDate);
       },
+
+      /**
+       * Filter the failed payment.
+       * @param builder
+       */
+      failedPayment(builder) {
+        builder.where('payment_status', SubscriptionPaymentStatus.Failed);
+      },
+
+      /**
+       * Filter the succeed payment.
+       * @param builder
+       */
+      succeedPayment(builder) {
+        builder.where('payment_status', SubscriptionPaymentStatus.Succeed);
+      },
     };
   }
 
@@ -108,10 +136,13 @@ export default class PlanSubscription extends mixin(SystemModel) {
 
   /**
    * Check if the subscription is active.
+   * Crtiria should be active:
+   *  - During the trial period should NOT be canceled.
+   *  - Out of trial period should NOT be ended.
    * @return {Boolean}
    */
   public active() {
-    return this.onTrial() || !this.ended();
+    return this.onTrial() ? !this.canceled() : !this.ended();
   }
 
   /**
@@ -200,4 +231,20 @@ export default class PlanSubscription extends mixin(SystemModel) {
     );
     return this.$query().update({ startsAt, endsAt });
   }
+
+  /**
+   * Detarmines the subscription payment whether is failed.
+   * @returns {boolean}
+   */
+  public isPaymentFailed() {
+    return this.paymentStatus === SubscriptionPaymentStatus.Failed;
+  }
+
+  /**
+   * Detarmines the subscription payment whether is succeed.
+   * @returns {boolean}
+   */
+  public isPaymentSucceed() {
+    return this.paymentStatus === SubscriptionPaymentStatus.Succeed;
+  }
 }

packages/server/src/system/repositories/SubscriptionRepository.ts

@@ -15,12 +15,8 @@ export default class SubscriptionRepository extends SystemRepository {
    * @param {number} tenantId
    */
   getBySlugInTenant(slug: string, tenantId: number) {
-    const cacheKey = this.getCacheKey('getBySlugInTenant', slug, tenantId);
-
-    return this.cache.get(cacheKey, () => {
-      return PlanSubscription.query()
-        .findOne('slug', slug)
-        .where('tenant_id', tenantId);
-    });
+    return PlanSubscription.query()
+      .findOne('slug', slug)
+      .where('tenant_id', tenantId);
   }
 }

packages/webapp/src/components/App.tsx

@@ -1,4 +1,5 @@
 // @ts-nocheck
+import { lazy, Suspense } from 'react';
 import { Router, Switch, Route } from 'react-router';
 import { createBrowserHistory } from 'history';
 import { QueryClientProvider, QueryClient } from 'react-query';
@@ -11,26 +12,27 @@ import 'moment/locale/es-us';
 import AppIntlLoader from './AppIntlLoader';
 import { EnsureAuthenticated } from '@/components/Guards/EnsureAuthenticated';
 import GlobalErrors from '@/containers/GlobalErrors/GlobalErrors';
-import DashboardPrivatePages from '@/components/Dashboard/PrivatePages';
-import { Authentication } from '@/containers/Authentication/Authentication';
 
-import LazyLoader from '@/components/LazyLoader';
 import { SplashScreen, DashboardThemeProvider } from '../components';
 import { queryConfig } from '../hooks/query/base';
-import { EnsureUserEmailVerified } from './Guards/EnsureUserEmailVerified';
-import { EnsureAuthNotAuthenticated } from './Guards/EnsureAuthNotAuthenticated';
 import { EnsureUserEmailNotVerified } from './Guards/EnsureUserEmailNotVerified';
-import { EnsureOneClickDemoAccountEnabled } from '@/containers/OneClickDemo/EnsureOneClickDemoAccountEnabled';
 
-const EmailConfirmation = LazyLoader({
-  loader: () => import('@/containers/Authentication/EmailConfirmation'),
-});
-const RegisterVerify = LazyLoader({
-  loader: () => import('@/containers/Authentication/RegisterVerify'),
-});
-const OneClickDemoPage = LazyLoader({
-  loader: () => import('@/containers/OneClickDemo/OneClickDemoPage'),
-});
+const DashboardPrivatePages = lazy(
+  () => import('@/components/Dashboard/PrivatePages'),
+);
+const AuthenticationPage = lazy(
+  () => import('@/containers/Authentication/AuthenticationPage'),
+);
+const EmailConfirmation = lazy(
+  () => import('@/containers/Authentication/EmailConfirmation'),
+);
+const RegisterVerify = lazy(
+  () => import('@/containers/Authentication/RegisterVerify'),
+);
+const OneClickDemoPage = lazy(
+  () => import('@/containers/OneClickDemo/OneClickDemoPage'),
+);
+
 /**
  * App inner.
  */
@@ -38,42 +40,27 @@ function AppInsider({ history }) {
   return (
     <div className="App">
       <DashboardThemeProvider>
-        <Router history={history}>
-          <Switch>
-            <Route path={'/one_click_demo'}>
-              <EnsureOneClickDemoAccountEnabled>
-                <EnsureAuthNotAuthenticated>
-                  <OneClickDemoPage />
-                </EnsureAuthNotAuthenticated>
-              </EnsureOneClickDemoAccountEnabled>
-            </Route>
-            <Route path={'/auth/register/verify'}>
-              <EnsureAuthenticated>
-                <EnsureUserEmailNotVerified>
-                  <RegisterVerify />
-                </EnsureUserEmailNotVerified>
-              </EnsureAuthenticated>
-            </Route>
+        <Suspense fallback={'Loading...'}>
+          <Router history={history}>
+            <Switch>
+              <Route path={'/one_click_demo'} children={<OneClickDemoPage />} />
+              <Route path={'/auth/register/verify'}>
+                <EnsureAuthenticated>
+                  <EnsureUserEmailNotVerified>
+                    <RegisterVerify />
+                  </EnsureUserEmailNotVerified>
+                </EnsureAuthenticated>
+              </Route>
 
-            <Route path={'/auth/email_confirmation'}>
-              <EmailConfirmation />
-            </Route>
-
-            <Route path={'/auth'}>
-              <EnsureAuthNotAuthenticated>
-                <Authentication />
-              </EnsureAuthNotAuthenticated>
-            </Route>
-
-            <Route path={'/'}>
-              <EnsureAuthenticated>
-                <EnsureUserEmailVerified>
-                  <DashboardPrivatePages />
-                </EnsureUserEmailVerified>
-              </EnsureAuthenticated>
-            </Route>
-          </Switch>
-        </Router>
+              <Route
+                path={'/auth/email_confirmation'}
+                children={<EmailConfirmation />}
+              />
+              <Route path={'/auth'} children={<AuthenticationPage />} />
+              <Route path={'/'} children={<DashboardPrivatePages />} />
+            </Switch>
+          </Router>
+        </Suspense>
 
         <GlobalErrors />
       </DashboardThemeProvider>

packages/webapp/src/components/Dashboard/PrivatePages.tsx

@@ -1,35 +1,37 @@
 // @ts-nocheck
-import React from 'react';
+import React, { lazy } from 'react';
 import { Switch, Route } from 'react-router';
 
 import Dashboard from '@/components/Dashboard/Dashboard';
-import SetupWizardPage from '@/containers/Setup/WizardSetupPage';
 
-import EnsureOrganizationIsReady from '../Guards/EnsureOrganizationIsReady';
-import EnsureOrganizationIsNotReady from '../Guards/EnsureOrganizationIsNotReady';
 import { PrivatePagesProvider } from './PrivatePagesProvider';
+import EnsureOrganizationIsReady from '../Guards/EnsureOrganizationIsReady';
+import { EnsureAuthenticated } from '../Guards/EnsureAuthenticated';
+import { EnsureUserEmailVerified } from '../Guards/EnsureUserEmailVerified';
 
 import '@/style/pages/Dashboard/Dashboard.scss';
 
+const SetupWizardPage = lazy(
+  () => import('@/containers/Setup/WizardSetupPage'),
+);
 /**
  * Dashboard inner private pages.
  */
 export default function DashboardPrivatePages() {
   return (
-    <PrivatePagesProvider>
-      <Switch>
-        <Route path={'/setup'}>
-          <EnsureOrganizationIsNotReady>
-            <SetupWizardPage />
-          </EnsureOrganizationIsNotReady>
-        </Route>
-
-        <Route path="/">
-          <EnsureOrganizationIsReady>
-            <Dashboard />
-          </EnsureOrganizationIsReady>
-        </Route>
-      </Switch>
-    </PrivatePagesProvider>
+    <EnsureAuthenticated>
+      <EnsureUserEmailVerified>
+        <PrivatePagesProvider>
+          <Switch>
+            <Route path={'/setup'} children={<SetupWizardPage />} />
+            <Route path="/">
+              <EnsureOrganizationIsReady>
+                <Dashboard />
+              </EnsureOrganizationIsReady>
+            </Route>
+          </Switch>
+        </PrivatePagesProvider>
+      </EnsureUserEmailVerified>
+    </EnsureAuthenticated>
   );
 }

packages/webapp/src/components/Dashboard/PrivatePagesProvider.tsx

@@ -1,6 +1,7 @@
 // @ts-nocheck
 import React from 'react';
 import { useApplicationBoot } from '@/components';
+import { useAuthMetadata } from '@/hooks/query/authentication';
 
 /**
  * Private pages provider.
@@ -9,7 +10,10 @@ export function PrivatePagesProvider({
   // #ownProps
   children,
 }) {
-  const { isLoading } = useApplicationBoot();
+  const { isLoading: isAppBootLoading } = useApplicationBoot();
+  const { isLoading: isAuthMetaLoading } = useAuthMetadata();
+
+  const isLoading = isAppBootLoading || isAuthMetaLoading;
 
   return <React.Fragment>{!isLoading ? children : null}</React.Fragment>;
 }

packages/webapp/src/components/LazyLoader.tsx

@@ -1,22 +0,0 @@
-// @ts-nocheck
-import * as React from 'react';
-import * as Loadable from 'react-loadable';
-
-const Loader = (config) =>
-  Loadable({
-    loading: (props) => {
-      if (props.error) {
-        /* tslint:disable */
-        console.error(`======= DefaultLoader Error =======`);
-        console.error(props.error);
-        console.error(`======= DefaultLoader Error =======`);
-        /* tslint:enable */
-        return null;
-      }
-      return null;
-    },
-    delay: 250,
-    ...config
-  });
-
-export default Loader;

packages/webapp/src/components/Preferences/PreferencesContentRoute.tsx

@@ -1,21 +1,33 @@
 // @ts-nocheck
-import React from 'react';
+import React, { Suspense } from 'react';
 import { Route, Switch } from 'react-router-dom';
-import preferencesRoutes from '@/routes/preferences';
+import { getPreferenceRoutes } from '@/routes/preferences';
+import { Spinner } from '@blueprintjs/core';
+import { Box } from '../Layout';
 
 export default function DashboardContentRoute() {
+  const preferencesRoutes = getPreferenceRoutes();
+
   return (
     <Route pathname="/preferences">
-      <Switch>
-        {preferencesRoutes.map((route, index) => (
-          <Route
-            key={index}
-            path={`${route.path}`}
-            exact={route.exact}
-            component={route.component}
-          />
-        ))}
-      </Switch>
+      <Suspense
+        fallback={
+          <Box style={{ padding: 20 }}>
+            <Spinner size={20} />
+          </Box>
+        }
+      >
+        <Switch>
+          {preferencesRoutes.map((route, index) => (
+            <Route
+              key={index}
+              path={`${route.path}`}
+              exact={route.exact}
+              component={route.component}
+            />
+          ))}
+        </Switch>
+      </Suspense>
     </Route>
   );
 }

packages/webapp/src/config.ts

@@ -1,6 +0,0 @@
-export const Config = {
-  oneClickDemo: {
-    enable: process.env.REACT_APP_ONE_CLICK_DEMO_ENABLE === 'true',
-    demoUrl: process.env.REACT_APP_DEMO_ACCOUNT_URL || '',
-  },
-};

packages/webapp/src/containers/Authentication/Authentication.tsx

@@ -2,10 +2,12 @@
 import { Route, Switch, useLocation } from 'react-router-dom';
 import BodyClassName from 'react-body-classname';
 import styled from 'styled-components';
+import { Suspense } from 'react';
 import { TransitionGroup, CSSTransition } from 'react-transition-group';
+import { Spinner } from '@blueprintjs/core';
 
 import authenticationRoutes from '@/routes/authentication';
-import { Icon, FormattedMessage as T } from '@/components';
+import { Box, Icon, FormattedMessage as T } from '@/components';
 import { AuthMetaBootProvider } from './AuthMetaBoot';
 
 import '@/style/pages/Authentication/Auth.scss';
@@ -20,7 +22,15 @@ export function Authentication() {
           </AuthLogo>
 
           <AuthMetaBootProvider>
-            <AuthenticationRoutes />
+            <Suspense
+              fallback={
+                <Box style={{ marginTop: '5rem' }}>
+                  <Spinner size={30} />
+                </Box>
+              }
+            >
+              <AuthenticationRoutes />
+            </Suspense>
           </AuthMetaBootProvider>
         </AuthInsider>
       </AuthPage>

packages/webapp/src/containers/Authentication/AuthenticationPage.tsx

@@ -0,0 +1,10 @@
+import { EnsureAuthNotAuthenticated } from "@/components/Guards/EnsureAuthNotAuthenticated";
+import { Authentication } from "./Authentication";
+
+export default function AuthenticationPage() {
+  return (
+    <EnsureAuthNotAuthenticated>
+      <Authentication />
+    </EnsureAuthNotAuthenticated>
+  );
+}

packages/webapp/src/containers/Entries/utils.tsx

@@ -9,9 +9,11 @@ import {
   compose,
   updateTableCell,
   updateAutoAddNewLine,
+  updateMinEntriesLines,
   orderingLinesIndexes,
   updateTableRow,
   formattedAmount,
+  updateRemoveLineByIndex,
 } from '@/utils';
 import { useItemEntriesTableContext } from './ItemEntriesTableProvider';
 

packages/webapp/src/containers/GlobalErrors/GlobalErrors.tsx

@@ -77,6 +77,15 @@ function GlobalErrors({
       },
     });
   }
+  if (globalErrors.subscriptionInactive) {
+    AppToaster.show({
+      message: `You can't add new data to Bigcapital because your subscription is inactive. Make sure your billing information is up-to-date from Preferences > Billing page.`,
+      intent: Intent.DANGER,
+      onDismiss: () => {
+        globalErrorsSet({ subscriptionInactive: false });
+      },
+    });
+  }
   if (globalErrors.userInactive) {
     AppToaster.show({
       message: intl.get('global_error.authorized_user_inactive'),

packages/webapp/src/containers/OneClickDemo/EnsureOneClickDemoAccountEnabled.tsx

@@ -1,6 +1,6 @@
 import React from 'react';
 import { Redirect } from 'react-router-dom';
-import { Config } from '@/config';
+import { useOneClickDemoBoot } from './OneClickDemoBoot';
 
 interface EnsureOneClickDemoAccountEnabledProps {
   children: React.ReactNode;
@@ -11,9 +11,10 @@ export const EnsureOneClickDemoAccountEnabled = ({
   children,
   redirectTo = '/',
 }: EnsureOneClickDemoAccountEnabledProps) => {
-  const enabeld = Config.oneClickDemo.enable || false;
+  const { authMeta } = useOneClickDemoBoot();
+  const enabled = authMeta?.meta?.one_click_demo?.enable || false;
 
-  if (!enabeld) {
+  if (!enabled) {
     return <Redirect to={{ pathname: redirectTo }} />;
   }
   return <>{children}</>;

packages/webapp/src/containers/OneClickDemo/OneClickDemoBoot.tsx

@@ -0,0 +1,45 @@
+import React, { createContext, useContext, ReactNode } from 'react';
+import { useAuthMetadata } from '@/hooks/query/authentication';
+
+interface OneClickDemoContextType {
+  authMeta: any;
+}
+
+const OneClickDemoContext = createContext<OneClickDemoContextType>(
+  {} as OneClickDemoContextType,
+);
+
+export const useOneClickDemoBoot = () => {
+  const context = useContext(OneClickDemoContext);
+
+  if (!context) {
+    throw new Error(
+      'useOneClickDemo must be used within a OneClickDemoProvider',
+    );
+  }
+  return context;
+};
+
+interface OneClickDemoBootProps {
+  children: ReactNode;
+}
+
+export const OneClickDemoBoot: React.FC<OneClickDemoBootProps> = ({
+  children,
+}) => {
+  const { isLoading: isAuthMetaLoading, data: authMeta } = useAuthMetadata();
+
+  const value = {
+    isAuthMetaLoading,
+    authMeta,
+  };
+
+  if (isAuthMetaLoading) {
+    return null;
+  }
+  return (
+    <OneClickDemoContext.Provider value={value}>
+      {children}
+    </OneClickDemoContext.Provider>
+  );
+};

packages/webapp/src/containers/OneClickDemo/OneClickDemoPage.tsx

@@ -1,97 +1,16 @@
-// @ts-nocheck
-import { Button, Intent, ProgressBar, Text } from '@blueprintjs/core';
-import { useEffect, useState } from 'react';
-import {
-  useCreateOneClickDemo,
-  useOneClickDemoSignin,
-} from '@/hooks/query/oneclick-demo';
-import { Box, Icon, Stack } from '@/components';
-import { useJob } from '@/hooks/query';
-import style from './OneClickDemoPage.module.scss';
+import { EnsureAuthNotAuthenticated } from '@/components/Guards/EnsureAuthNotAuthenticated';
+import { EnsureOneClickDemoAccountEnabled } from './EnsureOneClickDemoAccountEnabled';
+import { OneClickDemoBoot } from './OneClickDemoBoot';
+import { OneClickDemoPageContent } from './OneClickDemoPageContent';
 
 export default function OneClickDemoPage() {
-  const {
-    mutateAsync: createOneClickDemo,
-    isLoading: isCreateOneClickLoading,
-  } = useCreateOneClickDemo();
-  const {
-    mutateAsync: oneClickDemoSignIn,
-    isLoading: isOneclickDemoSigningIn,
-  } = useOneClickDemoSignin();
-
-  // Job states.
-  const [demoId, setDemoId] = useState<string>('');
-  const [buildJobId, setBuildJobId] = useState<string>('');
-  const [isJobDone, setIsJobDone] = useState<boolean>(false);
-
-  const {
-    data: { running, completed },
-  } = useJob(buildJobId, {
-    refetchInterval: 2000,
-    enabled: !isJobDone && !!buildJobId,
-  });
-
-  useEffect(() => {
-    if (completed) {
-      setIsJobDone(true);
-    }
-  }, [completed, setIsJobDone]);
-
-  // One the job done request sign-in using the demo id.
-  useEffect(() => {
-    if (isJobDone) {
-      oneClickDemoSignIn({ demoId }).then((res) => {
-        debugger;
-      });
-    }
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [isJobDone]);
-
-  const handleCreateAccountBtnClick = () => {
-    createOneClickDemo({})
-      .then(({ data: { data } }) => {
-        setBuildJobId(data?.build_job?.job_id);
-        setDemoId(data?.demo_id);
-      })
-      .catch(() => {});
-  };
-  const isLoading = running || isOneclickDemoSigningIn;
-
   return (
-    <Box className={style.root}>
-      <Box className={style.inner}>
-        <Stack align={'center'} spacing={40}>
-          <Icon icon="bigcapital" height={37} width={228} />
-
-          {isLoading && (
-            <Stack align={'center'} spacing={15}>
-              <ProgressBar stripes value={null} className={style.progressBar} />
-              {isOneclickDemoSigningIn && (
-                <Text className={style.waitingText}>
-                  It's signin-in to your demo account, Just a second!
-                </Text>
-              )}
-              {running && (
-                <Text className={style.waitingText}>
-                  We're preparing temporary environment for trial, It typically
-                  take few seconds. Do not close or refresh the page.
-                </Text>
-              )}
-            </Stack>
-          )}
-        </Stack>
-
-        {!isLoading && (
-          <Button
-            className={style.oneClickBtn}
-            intent={Intent.NONE}
-            onClick={handleCreateAccountBtnClick}
-            loading={isCreateOneClickLoading}
-          >
-            Create Demo Account
-          </Button>
-        )}
-      </Box>
-    </Box>
+    <EnsureAuthNotAuthenticated>
+      <OneClickDemoBoot>
+        <EnsureOneClickDemoAccountEnabled>
+          <OneClickDemoPageContent />
+        </EnsureOneClickDemoAccountEnabled>
+      </OneClickDemoBoot>
+    </EnsureAuthNotAuthenticated>
   );
 }

packages/webapp/src/containers/OneClickDemo/OneClickDemoPageContent.tsx

@@ -0,0 +1,98 @@
+// @ts-nocheck
+import { Button, Intent, ProgressBar, Text } from '@blueprintjs/core';
+import { useEffect, useState } from 'react';
+import {
+  useCreateOneClickDemo,
+  useOneClickDemoSignin,
+} from '@/hooks/query/oneclick-demo';
+import { Box, Icon, Stack } from '@/components';
+import { useJob } from '@/hooks/query';
+import style from './OneClickDemoPage.module.scss';
+
+export function OneClickDemoPageContent() {
+  const {
+    mutateAsync: createOneClickDemo,
+    isLoading: isCreateOneClickLoading,
+  } = useCreateOneClickDemo();
+  const {
+    mutateAsync: oneClickDemoSignIn,
+    isLoading: isOneclickDemoSigningIn,
+  } = useOneClickDemoSignin();
+
+  // Job states.
+  const [demoId, setDemoId] = useState<string>('');
+  const [buildJobId, setBuildJobId] = useState<string>('');
+  const [isJobDone, setIsJobDone] = useState<boolean>(false);
+
+  const {
+    data: { running, completed },
+  } = useJob(buildJobId, {
+    refetchInterval: 2000,
+    enabled: !isJobDone && !!buildJobId,
+  });
+
+  useEffect(() => {
+    if (completed) {
+      setIsJobDone(true);
+    }
+  }, [completed, setIsJobDone]);
+
+  // One the job done request sign-in using the demo id.
+  useEffect(() => {
+    if (isJobDone) {
+      oneClickDemoSignIn({ demoId }).then((res) => {
+        debugger;
+      });
+    }
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, [isJobDone]);
+
+  const handleCreateAccountBtnClick = () => {
+    createOneClickDemo({})
+      .then(({ data: { data } }) => {
+        setBuildJobId(data?.build_job?.job_id);
+        setDemoId(data?.demo_id);
+      })
+      .catch(() => {});
+  };
+  const isLoading = running || isOneclickDemoSigningIn;
+
+  return (
+    <Box className={style.root}>
+      <Box className={style.inner}>
+        <Stack align={'center'} spacing={40}>
+          <Icon icon="bigcapital" height={37} width={228} />
+
+          {isLoading && (
+            <Stack align={'center'} spacing={15}>
+              <ProgressBar stripes value={null} className={style.progressBar} />
+              {isOneclickDemoSigningIn && (
+                <Text className={style.waitingText}>
+                  It's signin-in to your demo account, Just a second!
+                </Text>
+              )}
+              {running && (
+                <Text className={style.waitingText}>
+                  We're preparing the temporary environment for trial. It
+                  typically takes a few seconds. Do not close or refresh the
+                  page.
+                </Text>
+              )}
+            </Stack>
+          )}
+        </Stack>
+
+        {!isLoading && (
+          <Button
+            className={style.oneClickBtn}
+            intent={Intent.NONE}
+            onClick={handleCreateAccountBtnClick}
+            loading={isCreateOneClickLoading}
+          >
+            Create Demo Account
+          </Button>
+        )}
+      </Box>
+    </Box>
+  );
+}

packages/webapp/src/containers/Setup/SetupLeftSection.tsx

@@ -6,7 +6,7 @@ import { Icon, For, FormattedMessage as T, Stack } from '@/components';
 import { getFooterLinks } from '@/constants/footerLinks';
 import { useAuthActions } from '@/hooks/state';
 import style from './SetupLeftSection.module.scss';
-import { Config } from '@/config';
+import { useAuthMetadata } from '@/hooks/query';
 
 /**
  * Footer item link.
@@ -28,13 +28,16 @@ function SetupLeftSectionFooter() {
   // Retrieve the footer links.
   const footerLinks = getFooterLinks();
 
+  const { data: authMeta } = useAuthMetadata();
+  const demoUrl = authMeta?.meta?.one_click_demo?.demo_url;
+
   const handleDemoBtnClick = () => {
-    window.open(Config.oneClickDemo.demoUrl);
+    window.open(demoUrl);
   };
 
   return (
     <div className={'content__footer'}>
-      {Config.oneClickDemo.demoUrl && (
+      {demoUrl && (
         <Stack spacing={16}>
           <Text className={style.demoButtonLabel}>Not Now?</Text>
           <button className={style.demoButton} onClick={handleDemoBtnClick}>

packages/webapp/src/containers/Setup/SetupSubscription/SubscriptionPlansOfferChecks.module.scss

@@ -0,0 +1,20 @@
+.container {
+  text-align: center;
+  margin-bottom: 1.15rem;
+}
+
+.iconText {
+  display: inline-flex;
+  font-size: 14px;
+  margin-right: 16px;
+  color: #00824d;
+
+  &:last-child {
+    margin-right: 0; /* Remove the margin on the last item */
+  }
+  
+}
+
+.icon {
+  margin-right: 2px;
+}

packages/webapp/src/containers/Setup/SetupSubscription/SubscriptionPlansOfferChecks.tsx

@@ -0,0 +1,35 @@
+import styles from './SubscriptionPlansOfferChecks.module.scss';
+
+export function SubscriptionPlansOfferChecks() {
+  return (
+    <div className={styles.container}>
+      <span className={styles.iconText}>
+        <svg
+          xmlns="http://www.w3.org/2000/svg"
+          height="18px"
+          width="18px"
+          viewBox="0 -960 960 960"
+          fill="rgb(0, 130, 77)"
+          className={styles.icon}
+        >
+          <path d="M378-225 133-470l66-66 179 180 382-382 66 65-448 448Z"></path>
+        </svg>
+        14-day free trial
+      </span>
+
+      <span className={styles.iconText}>
+        <svg
+          xmlns="http://www.w3.org/2000/svg"
+          height="18px"
+          width="18px"
+          viewBox="0 -960 960 960"
+          fill="rgb(0, 130, 77)"
+          className={styles.icon}
+        >
+          <path d="M378-225 133-470l66-66 179 180 382-382 66 65-448 448Z"></path>
+        </svg>
+        24/7 online support
+      </span>
+    </div>
+  );
+}

packages/webapp/src/containers/Setup/SetupSubscription/SubscriptionPlansPeriodSwitcher.tsx

@@ -24,7 +24,7 @@ function SubscriptionPlansPeriodSwitcherRoot({
     );
   };
   return (
-    <Group position={'center'} spacing={10} style={{ marginBottom: '1.2rem' }}>
+    <Group position={'center'} spacing={10} style={{ marginBottom: '1.6rem' }}>
       <Text>Pay Monthly</Text>
       <Switch
         large

packages/webapp/src/containers/Setup/SetupSubscription/SubscriptionPlansSection.tsx

@@ -1,6 +1,7 @@
 import { Callout } from '@blueprintjs/core';
 import { SubscriptionPlans } from './SubscriptionPlans';
 import { SubscriptionPlansPeriodSwitcher } from './SubscriptionPlansPeriodSwitcher';
+import { SubscriptionPlansOfferChecks } from './SubscriptionPlansOfferChecks';
 
 /**
  * Billing plans.
@@ -14,6 +15,7 @@ export function SubscriptionPlansSection() {
         include applicable taxes.
       </Callout>
 
+      <SubscriptionPlansOfferChecks />
       <SubscriptionPlansPeriodSwitcher />
       <SubscriptionPlans />
     </section>

packages/webapp/src/containers/Setup/WizardSetupPage.tsx

@@ -2,14 +2,17 @@
 import React from 'react';
 import SetupRightSection from './SetupRightSection';
 import SetupLeftSection from './SetupLeftSection';
+import EnsureOrganizationIsNotReady from '@/components/Guards/EnsureOrganizationIsNotReady';
 
 import '@/style/pages/Setup/SetupPage.scss';
 
 export default function WizardSetupPage() {
   return (
-    <div class="setup-page">
-      <SetupLeftSection />
-      <SetupRightSection />
-    </div>
+    <EnsureOrganizationIsNotReady>
+      <div class="setup-page">
+        <SetupLeftSection />
+        <SetupRightSection />
+      </div>
+    </EnsureOrganizationIsNotReady>
   );
-};
+}

packages/webapp/src/hooks/query/authentication.tsx

@@ -100,7 +100,7 @@ export const useAuthResetPassword = (props) => {
 /**
  * Fetches the authentication page metadata.
  */
-export const useAuthMetadata = (props) => {
+export const useAuthMetadata = (props = {}) => {
   return useRequestQuery(
     [t.AUTH_METADATA_PAGE],
     {

packages/webapp/src/hooks/useRequest.tsx

@@ -64,12 +64,20 @@ export default function useApiRequest() {
           setGlobalErrors({ too_many_requests: true });
         }
         if (status === 400) {
-          const lockedError = data.errors.find(
-            (error) => error.type === 'TRANSACTIONS_DATE_LOCKED',
-          );
-          if (lockedError) {
+          if (
+            data.errors.find(
+              (error) => error.type === 'TRANSACTIONS_DATE_LOCKED',
+            )
+          ) {
             setGlobalErrors({ transactionsLocked: { ...lockedError.data } });
           }
+          if (
+            data.errors.find(
+              (e) => e.type === 'ORGANIZATION.SUBSCRIPTION.INACTIVE',
+            )
+          ) {
+            setGlobalErrors({ subscriptionInactive: true });
+          }
           if (data.errors.find((e) => e.type === 'USER_INACTIVE')) {
             setGlobalErrors({ userInactive: true });
             setLogout();

packages/webapp/src/routes/authentication.tsx

@@ -1,43 +1,35 @@
 // @ts-nocheck
-import LazyLoader from '@/components/LazyLoader';
+import { lazy } from 'react';
 
 const BASE_URL = '/auth';
 
 export default [
   {
     path: `${BASE_URL}/login`,
-    component: LazyLoader({
-      loader: () => import('@/containers/Authentication/Login'),
-    }),
+    component: lazy(() => import('@/containers/Authentication/Login')),
   },
   {
     path: `${BASE_URL}/send_reset_password`,
-    component: LazyLoader({
-      loader: () => import('@/containers/Authentication/SendResetPassword'),
-    }),
+    component: lazy(
+      () => import('@/containers/Authentication/SendResetPassword'),
+    ),
   },
   {
     path: `${BASE_URL}/reset_password/:token`,
-    component: LazyLoader({
-      loader: () => import('@/containers/Authentication/ResetPassword'),
-    }),
+    component: lazy(() => import('@/containers/Authentication/ResetPassword')),
   },
   {
     path: `${BASE_URL}/invite/:token/accept`,
-    component: LazyLoader({
-      loader: () => import('@/containers/Authentication/InviteAccept'),
-    }),
+    component: lazy(() => import('@/containers/Authentication/InviteAccept')),
   },
   {
     path: `${BASE_URL}/register/email_confirmation`,
-    component: LazyLoader({
-      loader: () => import('@/containers/Authentication/EmailConfirmation'),
-    }),
+    component: lazy(
+      () => import('@/containers/Authentication/EmailConfirmation'),
+    ),
   },
   {
     path: `${BASE_URL}/register`,
-    component: LazyLoader({
-      loader: () => import('@/containers/Authentication/Register'),
-    }),
+    component: lazy(() => import('@/containers/Authentication/Register')),
   },
 ];

packages/webapp/src/routes/preferences.tsx

@@ -1,88 +1,96 @@
 // @ts-nocheck
 import { lazy } from 'react';
-import General from '@/containers/Preferences/General/General';
-import Users from '../containers/Preferences/Users/Users';
-import Roles from '../containers/Preferences/Users/Roles/RolesForm/RolesFormPage';
-import Accountant from '@/containers/Preferences/Accountant/Accountant';
-import Currencies from '@/containers/Preferences/Currencies/Currencies';
-import Item from '@/containers/Preferences/Item';
-// import SMSIntegration from '../containers/Preferences/SMSIntegration';
-import DefaultRoute from '../containers/Preferences/DefaultRoute';
-import Warehouses from '../containers/Preferences/Warehouses';
-import Branches from '../containers/Preferences/Branches';
-import Invoices from '../containers/Preferences/Invoices/PreferencesInvoices';
-import { PreferencesCreditNotes } from '../containers/Preferences/CreditNotes/PreferencesCreditNotes';
-import { PreferencesEstimates } from '@/containers/Preferences/Estimates/PreferencesEstimates';
-import { PreferencesReceipts } from '@/containers/Preferences/Receipts/PreferencesReceipts';
-
-import BillingPage from '@/containers/Subscriptions/BillingPage';
 
 const BASE_URL = '/preferences';
 
-export default [
+export const getPreferenceRoutes = () => [
   {
     path: `${BASE_URL}/general`,
-    component: General,
+    component: lazy(() => import('@/containers/Preferences/General/General')),
     exact: true,
   },
   {
     path: `${BASE_URL}/users`,
-    component: Users,
+    component: lazy(() => import('../containers/Preferences/Users/Users')),
     exact: true,
   },
   {
     path: `${BASE_URL}/invoices`,
-    component: Invoices,
+    component: lazy(
+      () => import('../containers/Preferences/Invoices/PreferencesInvoices'),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/credit-notes`,
-    component: PreferencesCreditNotes,
+    component: lazy(() =>
+      import(
+        '../containers/Preferences/CreditNotes/PreferencesCreditNotes'
+      ).then((module) => ({ default: module.PreferencesCreditNotes })),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/estimates`,
-    component: PreferencesEstimates,
+    component: lazy(() =>
+      import('@/containers/Preferences/Estimates/PreferencesEstimates').then(
+        (module) => ({ default: module.PreferencesEstimates }),
+      ),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/receipts`,
-    component: PreferencesReceipts,
+    component: lazy(() =>
+      import('@/containers/Preferences/Receipts/PreferencesReceipts').then(
+        (module) => ({ default: module.PreferencesReceipts }),
+      ),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/roles`,
-    component: Roles,
+    component: lazy(
+      () =>
+        import('../containers/Preferences/Users/Roles/RolesForm/RolesFormPage'),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/roles/:id`,
-    component: Roles,
+    component: lazy(
+      () =>
+        import('../containers/Preferences/Users/Roles/RolesForm/RolesFormPage'),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/currencies`,
-    component: Currencies,
+    component: lazy(
+      () => import('@/containers/Preferences/Currencies/Currencies'),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/warehouses`,
-    component: Warehouses,
+    component: lazy(() => import('../containers/Preferences/Warehouses')),
     exact: true,
   },
   {
     path: `${BASE_URL}/branches`,
-    component: Branches,
+    component: lazy(() => import('../containers/Preferences/Branches')),
     exact: true,
   },
   {
     path: `${BASE_URL}/accountant`,
-    component: Accountant,
+    component: lazy(
+      () => import('@/containers/Preferences/Accountant/Accountant'),
+    ),
     exact: true,
   },
   {
     path: `${BASE_URL}/items`,
-    component: Item,
+    component: lazy(() => import('@/containers/Preferences/Item')),
     exact: true,
   },
   // {
@@ -92,12 +100,12 @@ export default [
   // },
   {
     path: `${BASE_URL}/billing`,
-    component: BillingPage,
+    component: lazy(() => import('@/containers/Subscriptions/BillingPage')),
     exact: true,
   },
   {
     path: `${BASE_URL}/`,
-    component: DefaultRoute,
+    component: lazy(() => import('../containers/Preferences/DefaultRoute')),
     exact: true,
   },
 ];

packages/webapp/src/style/pages/Setup/SetupPage.scss

@@ -29,7 +29,7 @@
 
   &__content {
     width: 100%;
-    padding-bottom: 40px;
+    padding-bottom: 80px;
   }
 
   &__left-section {

pnpm-lock.yaml

@@ -86,6 +86,9 @@ importers:
       async:
         specifier: ^3.2.0
         version: 3.2.5
+      async-mutex:
+        specifier: ^0.5.0
+        version: 0.5.0
       axios:
         specifier: ^1.6.0
         version: 1.7.2
@@ -269,6 +272,9 @@ importers:
       pluralize:
         specifier: ^8.0.0
         version: 8.0.0
+      posthog-node:
+        specifier: ^4.2.0
+        version: 4.2.0
       pug:
         specifier: ^3.0.2
         version: 3.0.2
@@ -8009,6 +8015,12 @@ packages:
     resolution: {integrity: sha512-csOlWGAcRFJaI6m+F2WKdnMKr4HhdhFVBk0H/QbJFMCr+uO2kwohwXQPxw/9OCxp05r5ghVBFSyioixx3gfkNQ==}
     dev: false
 
+  /async-mutex@0.5.0:
+    resolution: {integrity: sha512-1A94B18jkJ3DYq284ohPxoXbfTA5HsQ7/Mf4DEhcyLx3Bz27Rh59iScbB6EPiP+B+joue6YCxcMXSbFC1tZKwA==}
+    dependencies:
+      tslib: 2.6.2
+    dev: false
+
   /async-settle@1.0.0:
     resolution: {integrity: sha512-VPXfB4Vk49z1LHHodrEQ6Xf7W4gg1w0dAPROHngx7qgDjqmIQ+fXmwgGXTW/ITLai0YLSvWepJOP9EVpMnEAcw==}
     engines: {node: '>= 0.10'}
@@ -8090,6 +8102,16 @@ packages:
     transitivePeerDependencies:
       - debug
 
+  /axios@1.7.7:
+    resolution: {integrity: sha512-S4kL7XrjgBmvdGut0sN3yJxqYzrDOnivkBiN0OFs6hLiUam3UPvswUo0kqGyhqUZGEOytHyumEdXsAkgCOUf3Q==}
+    dependencies:
+      follow-redirects: 1.15.6
+      form-data: 4.0.0
+      proxy-from-env: 1.1.0
+    transitivePeerDependencies:
+      - debug
+    dev: false
+
   /axobject-query@3.2.1:
     resolution: {integrity: sha512-jsyHu61e6N4Vbz/v18DHwWYKK0bSWLqn47eeDSKPB7m8tqMHF9YJ+mhIk2lVteyZrY8tnSj/jHOv4YiTCuCJgg==}
     dependencies:
@@ -20468,6 +20490,16 @@ packages:
       picocolors: 1.0.1
       source-map-js: 1.2.0
 
+  /posthog-node@4.2.0:
+    resolution: {integrity: sha512-hgyCYMyzMvuF3qWMw6JvS8gT55v7Mtp5wKWcnDrw+nu39D0Tk9BXD7I0LOBp0lGlHEPaXCEVYUtviNKrhMALGA==}
+    engines: {node: '>=15.0.0'}
+    dependencies:
+      axios: 1.7.7
+      rusha: 0.8.14
+    transitivePeerDependencies:
+      - debug
+    dev: false
+
   /prebuildify@6.0.1:
     resolution: {integrity: sha512-8Y2oOOateom/s8dNBsGIcnm6AxPmLH4/nanQzL5lQMU+sC0CMhzARZHizwr36pUPLdvBnOkCNQzxg4djuFSgIw==}
     hasBin: true
@@ -22722,6 +22754,10 @@ packages:
     engines: {node: '>=14'}
     dev: true
 
+  /rusha@0.8.14:
+    resolution: {integrity: sha512-cLgakCUf6PedEu15t8kbsjnwIFFR2D4RfL+W3iWFJ4iac7z4B0ZI8fxy4R3J956kAI68HclCFGL8MPoUVC3qVA==}
+    dev: false
+
   /rxjs@7.8.1:
     resolution: {integrity: sha512-AA3TVj+0A2iuIoQkWEK/tqFjBq2j+6PO6Y0zJcvzLAFhEFIO3HL0vls9hWLncZbAAbK0mar7oZ4V079I/qPMxg==}
     dependencies: